|
|
| | Magnesium acetylacetonate dihydrate Basic information |
| Product Name: | Magnesium acetylacetonate dihydrate | | Synonyms: | MAGNESIUM 2,4-PENTANEDIONATE;MAGNESIUM 2,4-PENTANEDIONATE, DIHYDRATE;MAGNESIUM ACETYLACETONATE DIHYDRATE;MAGNESIUM(II)ACETYLACETONATE DIHYDRATE;MAGNESIUM ACETYLACETONATE DEHYDRATE;mg(acac)2;Bis(acetylacetonato)magnesium dihydrate;Magnesium 2,4-pentanedionate dihydrate, typically 98+% (metals basis) | | CAS: | 68488-07-3 | | MF: | C10H18MgO6 | | MW: | 258.55 | | EINECS: | 628-792-9 | | Product Categories: | | | Mol File: | 68488-07-3.mol |  |
| | Magnesium acetylacetonate dihydrate Chemical Properties |
| Melting point | 265 °C (dec.)(lit.) | | storage temp. | Store at room temperature, keep dry and cool | | form | solid | | Specific Gravity | 1.356 | | Appearance | White to off-white Powder | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | 1S/2C5H8O2.Mg.2H2O/c2*1-4(6)3-5(2)7;;;/h2*3,6H,1-2H3;;2*1H2/q;;+2;;/p-2/b2*4-3-;;; | | InChIKey | LDRHDOBLZDBGOP-VGKOASNMSA-L | | SMILES | O.O.CC(=O)\C=C(\C)O[Mg]O\C(C)=C/C(C)=O |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38-40 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Carc. 2
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Magnesium acetylacetonate dihydrate Usage And Synthesis |
| Chemical Properties | white powder(s) [STR93] | | reaction suitability | core: magnesium |
| | Magnesium acetylacetonate dihydrate Preparation Products And Raw materials |
|