| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | rac-Ethylenebis(4,5,6,7-tetrahydro-1-indenyl)zirconium dichloride Basic information |
| Product Name: | rac-Ethylenebis(4,5,6,7-tetrahydro-1-indenyl)zirconium dichloride | | Synonyms: | DICHLORO-(R,R)-ETHYLENEBIS-(4,5,6,7-TETRAHYDRO-1-INDENYL)-ZIRCONIUM(IV);DICHLORO-(S,S)-ETHYLENEBIS-(4,5,6,7-TETRAHYDRO-1-INDENYL)-ZIRCONIUM(IV);(R)-ETHYLENEBIS(4,5,6,7-TETRAHYDRO-1-INDENYL)ZIRCONIUM DICHLORIDE;RAC-ETHYLENEBIS(4,5,6,7-TETRAHYDRO-1-INDENYL)ZIRCONIUM;RAC-ETHYLENEBIS(4,5,6,7-TETRAHYDRO-1-INDENYL)ZIRCONIUM(IV) DICHLORIDE;RAC-DICHLOROETHYLENEBIS-(4,5,6,7-TETRAHYDRO-1-INDENYL)-ZIRCONIUM(IV);(S)-ETHYLENEBIS(4,5,6,7-TETRAHYDRO-1-INDENYL)ZIRCONIUM DICHLORIDE;Dichloro[(R,R)-ethylenebis(4,5,6,7-tetrahydro-1-indenyl)]zirconium(IV) | | CAS: | 109429-79-0 | | MF: | C20H22Cl2Zr | | MW: | 426.53 | | EINECS: | | | Product Categories: | Asymmetric Synthesis;Chiral Catalysts, Ligands, and Reagents;Other Chiral Catalysts | | Mol File: | 109429-79-0.mol |  |
| | rac-Ethylenebis(4,5,6,7-tetrahydro-1-indenyl)zirconium dichloride Chemical Properties |
| Melting point | 267-271 °C(lit.) | | Optical Rotation | [α]20/D 89°, c = 1 in chloroform | | InChI | 1S/C20H24.2ClH.Zr/c1-3-7-19-15(5-1)9-11-17(19)13-14-18-12-10-16-6-2-4-8-20(16)18;;;/h9-12H,1-8,13-14H2;2*1H;/q;;;+2/p-2 | | InChIKey | AKXWJOYQORUUHS-UHFFFAOYSA-L | | SMILES | Cl[Zr]Cl.[CH]1[CH][C](CC[C]2[CH][CH][C]3CCCC[C]23)[C]4CCCC[C]14 |
| Hazard Codes | C | | Risk Statements | 36/37/38-34-22 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Corr. 1B |
| | rac-Ethylenebis(4,5,6,7-tetrahydro-1-indenyl)zirconium dichloride Usage And Synthesis |
| | rac-Ethylenebis(4,5,6,7-tetrahydro-1-indenyl)zirconium dichloride Preparation Products And Raw materials |
|