|
|
| | Boronic acid, (6-phenyl-2-naphthalenyl)- Basic information |
| Product Name: | Boronic acid, (6-phenyl-2-naphthalenyl)- | | Synonyms: | Boronic acid, (6-phenyl-2-naphthalenyl)-;-(6-phenyl-2-naphthalenyl) boronic acid;(2-Phenylnaphthalen-6-yl)boronic acid;6-Phenylnaphthalene-2-boronic acid, 98%;(6-Phenylnaphthalen-2-yl)boronic acid;6-phenylphthalen-2-yl-2-boronic acid;Boronic acid, (6-phenyl-2-phthalenyl)-;B-(6-phenyl-2-naphthalenyl)boronic acid | | CAS: | 876442-90-9 | | MF: | C16H13BO2 | | MW: | 248.08 | | EINECS: | | | Product Categories: | | | Mol File: | 876442-90-9.mol |  |
| | Boronic acid, (6-phenyl-2-naphthalenyl)- Chemical Properties |
| Boiling point | 478.4±43.0 °C(Predicted) | | density | 1.23±0.1 g/cm3 (20 ºC 760 Torr) | | storage temp. | 2-8°C | | form | Solid | | pka | 8.51±0.30(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C16H13BO2/c18-17(19)16-9-8-14-10-13(6-7-15(14)11-16)12-4-2-1-3-5-12/h1-11,18-19H | | InChIKey | XDKCHGWZDWHBQO-UHFFFAOYSA-N | | SMILES | B(C1=CC=C2C(=C1)C=CC(C1=CC=CC=C1)=C2)(O)O |
| | Boronic acid, (6-phenyl-2-naphthalenyl)- Usage And Synthesis |
| Chemical Properties | Class white powder |
| | Boronic acid, (6-phenyl-2-naphthalenyl)- Preparation Products And Raw materials |
|