|
|
| | 4-Bromobenzo[a]anthracene Basic information |
| | 4-Bromobenzo[a]anthracene Chemical Properties |
| Melting point | 215-216℃ | | Boiling point | 483℃ | | density | 1.477 | | Fp | 245℃ | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | Light yellow to Yellow to Green | | λmax | 213nm(lit.) | | InChI | InChI=1S/C18H11Br/c19-18-7-3-6-15-16(18)9-8-14-10-12-4-1-2-5-13(12)11-17(14)15/h1-11H | | InChIKey | ILVKEMDEUCXCAB-UHFFFAOYSA-N | | SMILES | C12=CC=CC(Br)=C1C=CC1C2=CC2C(=CC=CC=2)C=1 |
| | 4-Bromobenzo[a]anthracene Usage And Synthesis |
| Physical properties | benz[a]anthracene (BaA) is the core structure of 4-Bromobenzo[a]anthracene, BaA exhibits photoconductivity, at 100 V, the photocurrent continuously increases with increasing pressure.[1] | | References | [1] CAI W, ZHANG R, YAO Y, et al. Piezochromism and structural and electronic properties of benz[a]anthracene under pressure†[J]. Physical Chemistry Chemical Physics, 2017, 8: 6216-6223. DOI:10.1039/C6CP08171A.
|
| | 4-Bromobenzo[a]anthracene Preparation Products And Raw materials |
|