| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Chloroacrylic acid Basic information |
| Product Name: | 2-Chloroacrylic acid | | Synonyms: | 2-Chloro-2-propenoic acid;2-Chloropropenoic acid;2-chloro-2-propenoicaci;2-chloro-acrylicaci;2-Propenoic acid, 2-chloro-;Acrylic acid, 2-chloro-;ALPHA-CHLOROACRYLIC ACID;chloroacrylicacid | | CAS: | 598-79-8 | | MF: | C3H3ClO2 | | MW: | 106.51 | | EINECS: | 209-953-9 | | Product Categories: | monomer | | Mol File: | 598-79-8.mol |  |
| | 2-Chloroacrylic acid Chemical Properties |
| Melting point | 65°C | | Boiling point | 118.27°C (rough estimate) | | density | 1.2288 (rough estimate) | | refractive index | 1.4100 (estimate) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 2.41±0.11(Predicted) | | Appearance | White to off-white Solid | | Water Solubility | Soluble in water. | | BRN | 1098503 | | InChI | InChI=1S/C3H3ClO2/c1-2(4)3(5)6/h1H2,(H,5,6) | | InChIKey | SZTBMYHIYNGYIA-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(Cl)=C | | CAS DataBase Reference | 598-79-8(CAS DataBase Reference) | | NIST Chemistry Reference | Alpha-chloroacrylic acid(598-79-8) | | EPA Substance Registry System | 2-Chloroacrylic acid (598-79-8) |
| Risk Statements | 34 | | Safety Statements | 26-36/37/39 | | RIDADR | 3261 | | RTECS | AS5952000 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II |
| | 2-Chloroacrylic acid Usage And Synthesis |
| Uses | 2-Chloroacrylic acid is used as a halochemicals, organic synthesis. | | Definition | ChEBI: A chlorocarboxylic acid that is acrylic acid in which the hydrogen at position 2 is substituted by chlorine. |
| | 2-Chloroacrylic acid Preparation Products And Raw materials |
|