| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Hydroxy-2-(trifluoromethyl)quinoline Basic information |
| Product Name: | 4-Hydroxy-2-(trifluoromethyl)quinoline | | Synonyms: | 2-(TRIFLUOROMETHYL)-4-QUINOLINOL;2-(TRIFLUOROMETHYL)QUINOLIN-4-OL;BUTTPARK 29\04-06;4-Hydroxy-2-(trifluoromethyl)quinoline 95+%;4-Hydroxy-2-(trifluoromethyl)quinoline ,98%;NSC 232494;2-Trifluoromethyl-4-hydroxyquinoline;JR-8769, 2-(Trifluoromethyl)-4-quinolinol, 97% | | CAS: | 1701-18-4 | | MF: | C10H6F3NO | | MW: | 213.16 | | EINECS: | | | Product Categories: | | | Mol File: | 1701-18-4.mol |  |
| | 4-Hydroxy-2-(trifluoromethyl)quinoline Chemical Properties |
| Melting point | 209-211°C | | Boiling point | 299.1±35.0 °C(Predicted) | | density | 1.433±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 6.62±0.40(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C10H6F3NO/c11-10(12,13)9-5-8(15)6-3-1-2-4-7(6)14-9/h1-5H,(H,14,15) | | InChIKey | SUNAMHNJYSQUPL-UHFFFAOYSA-N | | SMILES | Oc1cc(nc2ccccc12)C(F)(F)F |
| Hazard Codes | Xi,T | | Risk Statements | 36/37/38-25 | | Safety Statements | 26-37/39-45 | | RIDADR | UN2811 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2933491090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| Provider | Language |
|
ALFA
| English |
| | 4-Hydroxy-2-(trifluoromethyl)quinoline Usage And Synthesis |
| Uses | 4-Hydroxy-2-trifluoromethylquinoline |
| | 4-Hydroxy-2-(trifluoromethyl)quinoline Preparation Products And Raw materials |
|