| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | CI 52000 Basic information |
| Product Name: | CI 52000 | | Synonyms: | Thionin acetate salt Certified≥ 85% (Dye content);Thionin acetate, Pure;THIONIN ACETATE;THIONIN, ACETATE SALT;THIONINE ACETATE;3,7-DIAMINO-5-PHENOTHIAZINIUM ACETATE;Thionin acetate, high purity biological stain, pure 5GR;THIONINE (ACETATE) (C.I. 52000) FOR MICR | | CAS: | 78338-22-4 | | MF: | C14H13N3O2S | | MW: | 287.34 | | EINECS: | 676-854-9 | | Product Categories: | Phenothiazine | | Mol File: | 78338-22-4.mol |  |
| | CI 52000 Chemical Properties |
| Melting point | >200℃ | | storage temp. | room temp | | solubility | Soluble in water, ethanol | | form | Crystals or Crystalline Powder | | pka | 2.5, 11.3(at 25℃) | | Colour Index | 52000 | | color | Dark green | | Odor | Stench odour | | PH Range | ~ 6.8 | | Water Solubility | Soluble in water (~2.5 mg/ml at 25°C), and HOAc: H2O (1:1) (1 mg/ml). Insoluble in ethanol. | | λmax | 598 nm | | ex/em | λex 605 nm; λem 621 nm in EtOH | | BRN | 4345073 | | Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. | | Biological Applications | Biosensors; diagnosis of diabetes; detecting ascorbic acid,uric acid,glucose,glomerular deposits | | InChI | 1S/C12H10N3S.C2H4O2/c13-7-1-3-9-11(5-7)16-12-6-8(14)2-4-10(12)15-9;1-2(3)4/h1-6H,13-14H2;1H3,(H,3,4)/q+1;/p-1 | | InChIKey | OWXBIRAFHWASMS-UHFFFAOYSA-M | | SMILES | CC([O-])=O.Nc1ccc2nc3ccc(N)cc3[s+]c2c1 | | CAS DataBase Reference | 78338-22-4(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 36/37/39-26 | | RIDADR | 2811 | | WGK Germany | 3 | | RTECS | SN5425000 | | HS Code | 29309090 | | Storage Class | 13 - Non Combustible Solids |
| | CI 52000 Usage And Synthesis |
| Chemical Properties | dark green powder or needle-like crystals | | Uses | Thionin acetate salt has been used in the Nissl stain for the labeling of neuronal cell bodies. | | Uses | Thionin Acetate Salt is a metachromic cationic histology dye. It can also be used in biological use and engineering or chemical process of controlled design and fabrication of SERS-SEF multifunctional nanoparticles for nanoprobe applications. Dyes and metabolites. | | Uses | Satisfactory in the churukian Schenk method for demonstrating metachromatic properties in mast cell tumors, spinal cord nissyl, and cartilage. | | Definition | ChEBI: Thionine acetate is an organic salt. It has a role as a fluorochrome. It contains a thionine cation. | | Biochem/physiol Actions | Thionin is a metachromatic cationic dye. It is widely used as a biological stain especially in histology. | | storage | Room temperature |
| | CI 52000 Preparation Products And Raw materials |
|