- Fmoc-hCys(Trt)-OH?
-
- $6400.00
-
2024-04-17
- CAS:167015-23-8
- Min. Order: 1Kg
- Purity: 99 %
- Supply Ability: 500 Kg
- FMOC-HOMOCYS(TRT)-OH
-
- $1.00
-
2019-07-06
- CAS:167015-23-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | Fmoc-HomoCys(Trt)-OH Basic information |
| Product Name: | Fmoc-HomoCys(Trt)-OH | | Synonyms: | N-ALPHA-(9-FLUORENYLMETHOXYCARBONYL)-S-TRITYL-L-HOMOCYSTEINE;N-ALPHA-(9-FLUORENYLMETHYLOXYCARBONYL)-S-TRITYL-L-HOMOCYSTEINE;(S)-2-(FMOC-AMINO)-4-TRITYLSULFANYL-BUTYRIC ACID;FMOC-HOMOCYSTEINE(TRT)-OH;(S)-2-(((9H-fluoren-9-yl)methoxy)carbonylamino)-4-(tritylthio)butanoic acid;N-Fmoc-S-trityl-L-homocysteine;FMoc-Hcys(Trt)-OH FMoc-S-trityl-L-HoMocysteine;Fmoc-S-trityl-L-homocysteine≥ 97% (HPLC) | | CAS: | 167015-23-8 | | MF: | C38H33NO4S | | MW: | 599.74 | | EINECS: | | | Product Categories: | amino acids;Unusual Amino Acids | | Mol File: | 167015-23-8.mol |  |
| | Fmoc-HomoCys(Trt)-OH Chemical Properties |
| Boiling point | 780.1±60.0 °C(Predicted) | | density | 1.256±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C | | pka | 3.84±0.10(Predicted) | | form | Solid | | color | White to off-white | | Optical Rotation | Consistent with structure | | Major Application | peptide synthesis | | InChIKey | FKBGJLDYRSFHBT-DHUJRADRSA-N | | SMILES | C(O)(=O)[C@H](CCSC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| Hazard Codes | Xi | | WGK Germany | WGK 1 | | HS Code | 29225090 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-HomoCys(Trt)-OH Usage And Synthesis |
| Chemical Properties | White to yellow powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-HomoCys(Trt)-OH Preparation Products And Raw materials |
|