| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
Dimethyl methoxymethylenemalonate manufacturers
|
| | Dimethyl methoxymethylenemalonate Basic information |
| Product Name: | Dimethyl methoxymethylenemalonate | | Synonyms: | METHOXYMETHYLENEMALONIC ACID DIMETHYL ESTER;DIMETHYL METHOXYMETHYLENEMALONATE;MMMM;Dimethyl methoxymethylenemalonate, 98+%;Dimethylmethoxymethylenmalonat;Propanedioic acid, 2-(methoxymethylene)-, 1,3-dimethyl ester;1,3-dimethyl 2-(methoxymethylidene)propanedioate;Dimethyl 2-(methoxymethylene) | | CAS: | 22398-14-7 | | MF: | C7H10O5 | | MW: | 174.15 | | EINECS: | 244-957-4 | | Product Categories: | fine chemicals | | Mol File: | 22398-14-7.mol |  |
| | Dimethyl methoxymethylenemalonate Chemical Properties |
| Melting point | 40-44 °C | | Boiling point | 98 °C (0.5 mmHg) | | density | 1.2311 (rough estimate) | | refractive index | 1.4390 (estimate) | | Fp | 158 °C | | storage temp. | Sealed in dry,Room Temperature | | form | Crystalline Solid | | color | White | | InChI | InChI=1S/C7H10O5/c1-10-4-5(6(8)11-2)7(9)12-3/h4H,1-3H3 | | InChIKey | RHFZTBSULNJWEI-UHFFFAOYSA-N | | SMILES | C(OC)(=O)/C(=C\OC)/C(OC)=O | | CAS DataBase Reference | 22398-14-7(CAS DataBase Reference) |
| | Dimethyl methoxymethylenemalonate Usage And Synthesis |
| Chemical Properties | white crystalline solid | | Uses | Dimethyl 2-(Methoxymethylene)malonate is a useful synthetic intermediate. It is used in preparation of (phenoxyethoxy)quinolones with antimalarial activities. It is also a reagent used in the synthesis of bicyclic pyridones prepn. as oral selective CB2 agonists with anti-pruritic activity. | | Synthesis |
264.2 g (2.0 mol) of dimethyl malonate, 637 g (6 mol) of trimethyl orthoformate and 20.4 g (0.2 mol) of acetic anhydride containing 2 g of H2 SO4 -activated bentonite were initially introduced into a reaction flask provided with a stirrer, thermometer, dropping funnel, column and reflux condensor, and the mixture was heated to boiling. 40.8 g (0.4 mol) of acetic anhydride was continuously metered for6 hours. The low boiling component formed was distilled off at a head temperature of 62° to 67° C. The bottom temperature increased slowly from 109° to 133° C. After 8 hours; the excess orthoester was distilled off at reduced pressure. 40.8 g (0.4 mol) of acetic anhydride was added to the remaining reaction mixture, and the mixture was heated at 140° C. for 2 hours. The catalyst was filtered off, and the crude product was distilled in vacuo. 330.4 g of dimethyl methoxymethylenemalonate (98% pure), having a melting point of 44° to 46° C., were obtained at 0.5 mbar and a head temperature of 110° C.
|
| | Dimethyl methoxymethylenemalonate Preparation Products And Raw materials |
|