- 2-Iodo-6-chloropurine
-
- $1.00 / 1KG
-
2019-12-24
- CAS:18552-90-4
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: G/KG/T
|
| | 2-Iodo-6-chloropurine Basic information |
| Product Name: | 2-Iodo-6-chloropurine | | Synonyms: | 6-chloro-2-iodo-7H-purine;6-Chloro-2-iodopurine 97%;9H-Purine,6-chloro-2-iodo-;6-Chloro-2-iodopurine;6-Chloro-2-iodo-1H-purine;2-Iodo-6-chloropurine;6-chloro-2-iodo-9H-purine/2-Iodo-6-chloropurine;6-chloro-2-iodo-9h-purine | | CAS: | 18552-90-4 | | MF: | C5H2ClIN4 | | MW: | 280.45 | | EINECS: | | | Product Categories: | Purine;Purines | | Mol File: | 18552-90-4.mol |  |
| | 2-Iodo-6-chloropurine Chemical Properties |
| Melting point | 198-203°C | | Boiling point | 296°C | | density | 2.75 | | Fp | 133°C | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | form | solid | | pka | 5.55±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C5H2ClIN4/c6-3-2-4(9-1-8-2)11-5(7)10-3/h1H,(H,8,9,10,11) | | InChIKey | SZRNPDHDBPGZOA-UHFFFAOYSA-N | | SMILES | N1C2C(=NC(I)=NC=2Cl)NC=1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 |
| | 2-Iodo-6-chloropurine Usage And Synthesis |
| Uses | 6-Chloro-2-iodopurine is used as a reagent in the synthesis of MRS 2500 Tetraammonium Salt (M750200); a highly potent and selective antagonist of the platelet P2Y1 receptor that inhibits ADP-induced aggregation of human platelets. 6-Chloro-2-iodopurine is also used in the preparation of methanocarba disubstituted adenine nucleosides as highly potent and selective A3 adenosine receptor agonists. |
| | 2-Iodo-6-chloropurine Preparation Products And Raw materials |
|