| Company Name: |
jiliang chemicals Gold
|
| Tel: |
21-62165282 15801962796; |
| Email: |
bidingchem@163.com |
| Products Intro: |
Product Name:2-HEPTENOIC ACID
CAS:10352-88-2
Purity:98.0% Package:5KG;1KG
|
|
| | 2-HEPTENOIC ACID Basic information |
| Product Name: | 2-HEPTENOIC ACID | | Synonyms: | RARECHEM AL BK 0163;TRANS-2-HEPTENOIC ACID;Heptenoicacidtech;(E)-hept-2-enoic acid;trans-2-Heptenoic acid, tech., 90%;(E)-2-HEPTENOICACID;HEPT-2-ENOIC ACID;2-HEPTENOIC ACID | | CAS: | 10352-88-2 | | MF: | C7H12O2 | | MW: | 128.17 | | EINECS: | 233-769-8 | | Product Categories: | | | Mol File: | 10352-88-2.mol |  |
| | 2-HEPTENOIC ACID Chemical Properties |
| Melting point | -19°C (estimate) | | Boiling point | 237.28°C (estimate) | | density | 0,955 g/cm3 | | FEMA | 3920 | (E)-2-HEPTENOIC ACID | | refractive index | 1.4288 (estimate) | | pka | 4.79±0.10(Predicted) | | Odor | rancid | | JECFA Number | 1373 | | InChI | InChI=1S/C7H12O2/c1-2-3-4-5-6-7(8)9/h5-6H,2-4H2,1H3,(H,8,9)/b6-5+ | | InChIKey | YURNCBVQZBJDAJ-AATRIKPKSA-N | | SMILES | C(O)(=O)/C=C/CCCC | | LogP | 2.40 |
| Provider | Language |
|
ALFA
| English |
| | 2-HEPTENOIC ACID Usage And Synthesis |
| Chemical Properties | (E)-2-Heptenoic acid has a disagreeable rancid aroma. | | Definition | ChEBI: A 2-heptenoic acid having the trans configuration. |
| | 2-HEPTENOIC ACID Preparation Products And Raw materials |
|