|
|
| | Methyl 5-methylisoxazole-3-carboxylate Basic information |
| Product Name: | Methyl 5-methylisoxazole-3-carboxylate | | Synonyms: | 3-Isoxazolecarboxylicacid,5-methyl-,methylester(6CI,7CI,8CI,9CI);METHYL 5-5ETHYLISOXAZOLE-3-CARBOXYLATE;5-Methyl-3-isoxazolecarboxylic acid methyl ester;Methyl 5-methylisoxazole-3-carboxylate,98%;3-Isoxazolecarboxylic acid, 5-Methyl-, Methyl ester;Methyl 5-methyl-1,2-oxazole-3-carboxylate, 3-(Methoxycarbonyl)-5-methylisoxazole;5-METHYLISOXAZOLE-3-CARBOXYLIC ACID METHYL ESTER;METHYL 5-METHYL-3-ISOXAZOLECARBOXYLATE | | CAS: | 19788-35-3 | | MF: | C6H7NO3 | | MW: | 141.12 | | EINECS: | 243-311-9 | | Product Categories: | CARBOXYLICESTER;Heterocycles series | | Mol File: | 19788-35-3.mol |  |
| | Methyl 5-methylisoxazole-3-carboxylate Chemical Properties |
| Melting point | 90-92 °C | | Boiling point | 125°C 11mm | | density | 1.179±0.06 g/cm3(Predicted) | | Fp | 125°C/11mm | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | solid | | pka | -5.08±0.50(Predicted) | | color | White to off-white | | BRN | 115704 | | InChI | InChI=1S/C6H7NO3/c1-4-3-5(7-10-4)6(8)9-2/h3H,1-2H3 | | InChIKey | MVHHQOCEOUNTID-UHFFFAOYSA-N | | SMILES | O1C(C)=CC(C(OC)=O)=N1 | | CAS DataBase Reference | 19788-35-3(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Isoxazolecarboxylic acid, 5-methyl-, methyl ester(19788-35-3) |
| | Methyl 5-methylisoxazole-3-carboxylate Usage And Synthesis |
| Chemical Properties | white to off-white crystalline powder | | Uses | Methyl 5-Methyl-3-isoxazolecarboxylate is a related compound of Leflunomide (L322750), an antirheumatic compound used to treat rheumatoid arthritis and psoriatic arthritis. Leflunomide also inhibits dihydroorotate dehydrogenase. |
| | Methyl 5-methylisoxazole-3-carboxylate Preparation Products And Raw materials |
|