| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3'-Formylbiphenyl-4-carboxylic acid methyl ester Basic information |
| Product Name: | 3'-Formylbiphenyl-4-carboxylic acid methyl ester | | Synonyms: | METHYL 4-(3-FORMYLPHENYL)BENZOATE;METHYL 3'-FORMYL[1,1'-BIPHENYL]-4-CARBOXYLATE;SALOR-INT L480606-1EA;4-(3-FORMYLPHENYL)BENZOIC ACID METHYL ESTER;AKOS BAR-0263;4-(3-(Formylphenyl)phenylsulfonic acid;Methyl 4-(3-formylphenyl)benzoate 97%;methyl 3'-formylbiphenyl-4-carboxylate | | CAS: | 221021-36-9 | | MF: | C15H12O3 | | MW: | 240.25 | | EINECS: | | | Product Categories: | | | Mol File: | 221021-36-9.mol |  |
| | 3'-Formylbiphenyl-4-carboxylic acid methyl ester Chemical Properties |
| Melting point | 97-101 °C | | Boiling point | 402.4±38.0 °C(Predicted) | | density | 1.176±0.06 g/cm3(Predicted) | | form | solid | | InChI | 1S/C15H12O3/c1-18-15(17)13-7-5-12(6-8-13)14-4-2-3-11(9-14)10-16/h2-10H,1H3 | | InChIKey | AQDLVJIWBSWMFZ-UHFFFAOYSA-N | | SMILES | COC(=O)c1ccc(cc1)-c2cccc(C=O)c2 |
| Hazard Codes | N,Xi | | Risk Statements | 50/53 | | Safety Statements | 60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2918300090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 |
| | 3'-Formylbiphenyl-4-carboxylic acid methyl ester Usage And Synthesis |
| | 3'-Formylbiphenyl-4-carboxylic acid methyl ester Preparation Products And Raw materials |
|