|
|
| | 2-Hydroxy-6-methylpyridine-3-carboxylic acid Basic information |
| | 2-Hydroxy-6-methylpyridine-3-carboxylic acid Chemical Properties |
| Melting point | 233-235 °C(lit.) | | Boiling point | 276.03°C (rough estimate) | | density | 1.3585 (rough estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 2.54±0.20(Predicted) | | form | powder to crystal | | color | Light orange to Yellow to Green | | BRN | 129164 | | InChI | InChI=1S/C7H7NO3/c1-4-2-3-5(7(10)11)6(9)8-4/h2-3H,1H3,(H,8,9)(H,10,11) | | InChIKey | XRIHTJYXIHOBDQ-UHFFFAOYSA-N | | SMILES | C1(=O)NC(C)=CC=C1C(O)=O | | CAS DataBase Reference | 38116-61-9(CAS DataBase Reference) |
| | 2-Hydroxy-6-methylpyridine-3-carboxylic acid Usage And Synthesis |
| Chemical Properties | light yellow to light orange crystalline powder, | | Uses | 2-Hydroxy-6-methylnicotinic acid is a useful research chemical compound used in the preparation of orally bioavailable thrombin inhibitors. |
| | 2-Hydroxy-6-methylpyridine-3-carboxylic acid Preparation Products And Raw materials |
|