METHYL 8-BROMOOCTANOATE manufacturers
|
| | METHYL 8-BROMOOCTANOATE Basic information |
| Product Name: | METHYL 8-BROMOOCTANOATE | | Synonyms: | METHYL 8-BROMOOCTANOATE;8-Bromooctanoicacidmethylester;Bromooctanoicacidmethylester;2-Bromocaprylic acid, methyl ester;Methyl bromooctanoate;Octanoic acid,8-bromo-, methyl ester;Methyl8-bromooctanoate , Methyl8-bromooctanoate;Semaglutide Impurity 5 | | CAS: | 26825-92-3 | | MF: | C9H17BrO2 | | MW: | 237.13 | | EINECS: | | | Product Categories: | | | Mol File: | 26825-92-3.mol |  |
| | METHYL 8-BROMOOCTANOATE Chemical Properties |
| Boiling point | 124 °C(Press: 6 Torr) | | density | 1.223±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C9H17BrO2/c1-12-9(11)7-5-3-2-4-6-8-10/h2-8H2,1H3 | | InChIKey | IZIJRYNUYQXBPG-UHFFFAOYSA-N | | SMILES | C(OC)(=O)CCCCCCCBr |
| | METHYL 8-BROMOOCTANOATE Usage And Synthesis |
| | METHYL 8-BROMOOCTANOATE Preparation Products And Raw materials |
|