|
|
| | Sodium 3-nitrobenzoate Basic information |
| | Sodium 3-nitrobenzoate Chemical Properties |
| Melting point | >300°C | | refractive index | 1.492 | | storage temp. | Store below +30°C. | | solubility | 10.9g/l | | form | crystalline | | color | off-white to yellow | | Water Solubility | Soluble in water. | | BRN | 4166479 | | InChI | InChI=1S/C7H5NO4.Na.H/c9-7(10)5-2-1-3-6(4-5)8(11)12;;/h1-4H,(H,9,10);; | | InChIKey | WQZWULWAPBNSEY-UHFFFAOYSA-N | | SMILES | C(C1C=CC=C(N(=O)=O)C=1)(=O)O.[NaH] | | CAS DataBase Reference | 827-95-2(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 3-nitro-, sodium salt (827-95-2) |
| Hazard Codes | F,Xi | | Risk Statements | 11-36/37/38-22 | | Safety Statements | 16-26-36-36/37-22 | | RIDADR | UN 1325 4.1/PG 2 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 4.1 | | PackingGroup | III | | HS Code | 29163990 | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Eye Irrit. 2
Flam. Sol. 1
Skin Irrit. 2
STOT SE 3 |
| | Sodium 3-nitrobenzoate Usage And Synthesis |
| Chemical Properties | Light yellow solid | | Uses | Sodium 3-nitrobenzoate is an important organic intermediate. It can be used in agrochemical, pharmaceutical and dyestuff field. |
| | Sodium 3-nitrobenzoate Preparation Products And Raw materials |
|