| Company Name: |
ChemeGen(Shanghai) Biotechnology Co.,Ltd. Gold
|
| Tel: |
18818260767 |
| Email: |
sales@chemegen.com |
| Products Intro: |
Product Name:N-Oleoyl Dopamine
CAS:105955-11-1
Purity:98% Package:10 mg;50 mg;100 mg;500 mg;1 g;5 g;10 g
|
| Company Name: |
3B Pharmachem (Wuhan) International Co.,Ltd.
|
| Tel: |
821-50328103-801 18930552037 |
| Email: |
3bsc@sina.com |
| Products Intro: |
Product Name:OLDA;(9Z)-N-[2-(3,4-Dihydroxyphenyl)ethyl]-9-octadecenaMide
CAS:105955-11-1
Purity:99% HPLC Package:1Mg ; 5Mg;10Mg ;100Mg;250Mg ;500Mg ;1g;2.5g ;5g ;10g
|
| Company Name: |
Dalian Meilun Biotech Co., Ltd.
|
| Tel: |
0411-62910999 13889544652 |
| Email: |
sales@meilune.com |
| Products Intro: |
Product Name:N-Oleoyl Dopamine(OLDA)
CAS:105955-11-1
Purity:>98%,BR Package:10MG Remarks:MB2865
|
|
| Product Name: | OLDA | | Synonyms: | (9Z)-N-[2-(3,4-DIHYDROXYPHENYL)ETHYL]-9-OCTADECENAMIDE;N-[2-(3,4-DIHYDROXYPHENYL)ETHYL]9Z-OCTADECENAMIDE;OLDA;ODA;N-OLEOYLDOPAMINE;N-Oleoyldopamine (OLDA);(Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]octadec-9-enamide;9-Octadecenamide, N-[2-(3,4-dihydroxyphenyl)ethyl]-, (9Z)- | | CAS: | 105955-11-1 | | MF: | C26H43NO3 | | MW: | 417.62 | | EINECS: | | | Product Categories: | Vanilloid/TRPV channel | | Mol File: | 105955-11-1.mol |  |
| Melting point | 60-61oC | | Boiling point | 619.5±55.0 °C(Predicted) | | density | 1.004±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | DMSO: ~20 mg/mL, soluble | | form | powder | | pka | 9.79±0.10(Predicted) | | color | white | | InChIKey | QQBPLXNESPTPNU-KTKRTIGZSA-N | | SMILES | C(NCCC1=CC=C(O)C(O)=C1)(=O)CCCCCCC/C=C\CCCCCCCC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 |
| Uses | N-Oleoyldopamine is a bioactive lipid found in the mammalian brain that selectively activates the transient receptor potential vanilloid type 1 (TRPV1) channel. It is also a 5-lipoxygenase inhibitor. | | Definition | ChEBI: N-oleoyldopamine is a fatty amide resulting from the formal condensation of the carboxy group of oleic acid with the amino group of dopamine. Synthesised in catecholaminergic neurons, it crosses the blood-brain barrier and might be considered as a carrier of dopamine into the brain. It is a transient receptor potential vanilloid type 1 (TRPV1) receptor agonist. It has a role as a TRPV1 agonist. It is a fatty amide, a secondary carboxamide, a member of catechols and a N-(fatty acyl)-dopamine. It is functionally related to a dopamine and an oleic acid. | | Biological Activity | Potent endogenous vanilloid TRPV1 (VR1) receptor agonist (EC 50 = 36 nM at hVR1) with low affinity for rCB 1 receptors (K i = 1.6 μ M). Potently induces VR1-mediated thermal hyperalgesia in rats in vivo . | | storage | Desiccate at -20°C |
| | OLDA Preparation Products And Raw materials |
|