| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
4-(N,N-Dimethylamino)azobenzene-4'-isothiocyanate manufacturers
|
| | 4-(N,N-Dimethylamino)azobenzene-4'-isothiocyanate Basic information |
| Product Name: | 4-(N,N-Dimethylamino)azobenzene-4'-isothiocyanate | | Synonyms: | 4-((4-ISOTHIOCYANATOPHENYL)AZO)-N N- &;Benzenamine, 4-(4-isothiocyanatophenyl)azo-N,N-dimethyl-;4-(4-ISOTHIOCYANATOPHENYLAZO)-N,N-DIMETHYLANILINE;4-DIMETHYLAMINOAZOBENZENE 4'-ISOTHIOCYANATE;4-N,N-DIMETHYLAMINOAZOBENZENE-4-ISOTHIOCYANATE;[4'-(Dimethylamino)azobenzene-4-yl] isothiocyanate;4-(Dimethylamino)-4'-isothiocyanatoazobenzene;4-[4-(Dimethylamino)phenylazo]phenyl isothiocyanate | | CAS: | 7612-98-8 | | MF: | C15H14N4S | | MW: | 282.36 | | EINECS: | 231-521-3 | | Product Categories: | marker | | Mol File: | 7612-98-8.mol |  |
| | 4-(N,N-Dimethylamino)azobenzene-4'-isothiocyanate Chemical Properties |
| Melting point | 167-171 °C(lit.) | | Boiling point | 466.2±30.0 °C(Predicted) | | density | 1.2493 (rough estimate) | | refractive index | 1.5700 (estimate) | | storage temp. | room temp | | solubility | dioxane: 20 mg/mL, clear, red | | pka | 3.28±0.10(Predicted) | | form | powder to crystal | | color | Orange to Brown | | Sensitive | Moisture Sensitive | | BRN | 752568 | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | 1S/C15H14N4S/c1-19(2)15-9-7-14(8-10-15)18-17-13-5-3-12(4-6-13)16-11-20/h3-10H,1-2H3/b18-17+ | | InChIKey | OSWZKAVBSQAVFI-ISLYRVAYSA-N | | SMILES | CN(C)c1ccc(cc1)\N=N\c2ccc(cc2)N=C=S | | CAS DataBase Reference | 7612-98-8(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 42 | | Safety Statements | 22-24/25 | | RIDADR | 3234 | | WGK Germany | 3 | | RTECS | NX9125000 | | F | 10-21 | | HazardClass | IRRITANT | | HS Code | 29309090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Resp. Sens. 1 Skin Sens. 1 |
| | 4-(N,N-Dimethylamino)azobenzene-4'-isothiocyanate Usage And Synthesis |
| Chemical Properties | Rust crystalline powder | | Uses | 4-(4-Isothiocyanatophenylazo)-N,N-dimethylaniline is a stain/dye. Dyes and metabolites. | | Purification Methods | Crystallise DABITC by dissolving 1g in 150mL of boiling Me2CO, filtering hot and allowing to cool at -20o overnight, collecting the solid and drying it in a vacuum. Solutions in pyridine should be used immediately, otherwise it decomposes. It is moisture sensitive. [Chang Methods Enzymol 91 79, 455 1983.] |
| | 4-(N,N-Dimethylamino)azobenzene-4'-isothiocyanate Preparation Products And Raw materials |
|