| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Phenyl phosphate disodium salt Basic information |
| Product Name: | Phenyl phosphate disodium salt | | Synonyms: | Disodiumphenylphosphate,dihy;PhenylPhosphateDisodiumSaltGr;PHENYL PHOSPHATE DISODIUM SALT GR DIHYDRATE;PHENYLPHOSPHATE DISODIUM SALT extrapure AR;phenyl disodium orthophosphate;DISODIUM PHENYL-(O)-PHOSPHATE;DI-SODIUM PHENYL PHOSPHAT DIHYDRATE;DISODIUM PHENYLPHOSPHATE | | CAS: | 3279-54-7 | | MF: | C6H8NaO4P | | MW: | 198.09 | | EINECS: | 221-917-4 | | Product Categories: | | | Mol File: | 3279-54-7.mol |  |
| | Phenyl phosphate disodium salt Chemical Properties |
| Melting point | >300°C | | storage temp. | 2-8°C | | solubility | H2O: 0.1 g/mL, clear | | form | Crystalline | | color | Pale yellow | | PH | pH (50g/l, 25℃) : 6.5~9.5 | | Water Solubility | Soluble in water (0.1 g/mL). | | Sensitive | Hygroscopic | | Merck | 14,3357 | | BRN | 4167154 | | Stability: | Hygroscopic | | InChI | InChI=1S/C6H7O4P.Na.H/c7-11(8,9)10-6-4-2-1-3-5-6;;/h1-5H,(H2,7,8,9);; | | InChIKey | FILAJVPXXCLSKZ-UHFFFAOYSA-N | | SMILES | O(C1C=CC=CC=1)P(O)(O)=O.[NaH] | | CAS DataBase Reference | 3279-54-7(CAS DataBase Reference) | | EPA Substance Registry System | Disodium phenyl phosphate (3279-54-7) |
| Provider | Language |
|
ALFA
| English |
| | Phenyl phosphate disodium salt Usage And Synthesis |
| Chemical Properties | Crystalline | | Uses | Reagent in the testing of milk for proper pasteurization and for the presence of unpasteurized milk. | | Uses | Phenyl phosphate disodium salt is used in phosphatase determinations. It is also used as reagent in chemical research. | | Purification Methods | Dissolve it in a minimum amount of methanol, filtering off any insoluble residue of inorganic phosphate, then precipitate it by adding an equal volume of Et2O. Wash the solid with Et2O and dry it in a vacuum [Tsuboi Biochim Biophys Acta 8 173 1952]. [Beilstein 6 IV 708.] |
| | Phenyl phosphate disodium salt Preparation Products And Raw materials |
|