|
|
| | Methyl (S)-2-(Boc-amino)-3-[(S)-2-oxo-3-pyrrolidinyl]propanoate Basic information |
| Product Name: | Methyl (S)-2-(Boc-amino)-3-[(S)-2-oxo-3-pyrrolidinyl]propanoate | | Synonyms: | Methyl (S)-2-(Boc-amino)-3-[(S)-2-oxo-3-pyrrolidinyl]propanoate;3-Pyrrolidinepropanoic acid, α-[[(1,1-dimethylethoxy)carbonyl]amino]-2-oxo-, methyl ester, (αS,3S)-;Methyl (αS,3S)-α-[[(1,1-dimethylethoxy)carbonyl]amino]-2-oxo-3-pyrrolidinepropanoate;(S)-METHYL 2-((TERT-BUTOXYCARBONYL)AMINO)-;3S)-α-[(tert-Butyloxycarbonyl)aMino]-2-oxo-3-pyrrolidinepropanoic acid Methyl Ester; (alphaS,3S)-alpha-[(tert-Butyloxycarbonyl)amino]-2-oxo-3-pyrrolidinepropanoic acid Methyl Ester;Methyl (S)-2-(Boc-amino)-3-[(S)-2-oxo-3-pyrrolidinyl]propanoateRBOXYLIC ACID METHYL ESTER HYDROCHLORIDE;(2S)-2-(tert-butoxycarbonylamino)-3-[(3'S)-2'-oxo-3'-pyrrolidinyl]propanoic acid methy ester | | CAS: | 328086-60-8 | | MF: | C13H22N2O5 | | MW: | 286.32 | | EINECS: | | | Product Categories: | Amines, Heterocycles, Pharmaceuticals, Intermediates & Fine Chemicals;1;GYL | | Mol File: | 328086-60-8.mol | ![Methyl (S)-2-(Boc-amino)-3-[(S)-2-oxo-3-pyrrolidinyl]propanoate Structure](CAS/20210111/GIF/328086-60-8.gif) |
| | Methyl (S)-2-(Boc-amino)-3-[(S)-2-oxo-3-pyrrolidinyl]propanoate Chemical Properties |
| Melting point | 110-114°C | | Boiling point | 471.5±20.0 °C(Predicted) | | density | 1.142±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 10.97±0.46(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C13H22N2O5/c1-13(2,3)20-12(18)15-9(11(17)19-4)7-8-5-6-14-10(8)16/h8-9H,5-7H2,1-4H3,(H,14,16)(H,15,18)/t8-,9-/m0/s1 | | InChIKey | HTQMBOWAEPNWLI-IUCAKERBSA-N | | SMILES | [C@H](C(=O)OC)(NC(=O)OC(C)(C)C)C[C@@H]1CCNC1=O |
| | Methyl (S)-2-(Boc-amino)-3-[(S)-2-oxo-3-pyrrolidinyl]propanoate Usage And Synthesis |
| Description | Methyl (S)-2-(Boc-amino)-3-[(S)-2-oxo-3-pyrrolidinyl]propanoate is a carboxylate derivative and can be used as a pharmaceutical intermediate.Used in the preparation of protease inhibitor. | | Uses | (αS,3S)-α-[(tert-Butyloxycarbonyl)aMino]-2-oxo-3-pyrrolidinepropanoic acid Methyl Ester is used in the preparation of protease inhibitor. |
| | Methyl (S)-2-(Boc-amino)-3-[(S)-2-oxo-3-pyrrolidinyl]propanoate Preparation Products And Raw materials |
|