| Company Name: |
RYSS TECH LTD |
| Tel: |
400-188-0725 +86 21 34310725 13611771617 |
| Email: |
|
4,4-DIPHENYLSEMICARBAZIDE manufacturers
|
| | 4,4-DIPHENYLSEMICARBAZIDE Basic information |
| Product Name: | 4,4-DIPHENYLSEMICARBAZIDE | | Synonyms: | n,n-diphenyl-hydrazinecarboxamid;N,N-Diphenylhydrazinecarboxamide;Semicarbazide, 4,4-diphenyl-;4,4-DIPHENYLSEMICARBAZIDE;4 4-DIPHENYLSEMICARBAZIDE 98%;4,4-Diphenylsemicarbazide,98%;Hydrazinecarboxamide, N,N-diphenyl-;4,4-Diphenyl-semicarbazol | | CAS: | 603-51-0 | | MF: | C13H13N3O | | MW: | 227.26 | | EINECS: | 210-046-5 | | Product Categories: | | | Mol File: | 603-51-0.mol |  |
| | 4,4-DIPHENYLSEMICARBAZIDE Chemical Properties |
| Melting point | 151-152 °C(lit.) | | Boiling point | 368.98°C (rough estimate) | | density | 1.1267 (rough estimate) | | refractive index | 1.5600 (estimate) | | storage temp. | Storage temp. 2-8°C | | pka | 12.25±0.20(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | 1S/C13H13N3O/c14-15-13(17)16(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,14H2,(H,15,17) | | SMILES | O=C(NN)N(C1=CC=CC=C1)C2=CC=CC=C2 | | EPA Substance Registry System | Hydrazinecarboxamide, N,N-diphenyl- (603-51-0) |
| WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | 4,4-DIPHENYLSEMICARBAZIDE Usage And Synthesis |
| Chemical Properties | white to brown crystalline powder |
| | 4,4-DIPHENYLSEMICARBAZIDE Preparation Products And Raw materials |
|