5-Amino-6-nitroquinoline manufacturers
|
| | 5-Amino-6-nitroquinoline Basic information |
| | 5-Amino-6-nitroquinoline Chemical Properties |
| Melting point | 272-273 °C (dec.) (lit.) | | Boiling point | 324.42°C (rough estimate) | | density | 1.3249 (rough estimate) | | refractive index | 1.6500 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.81±0.15(Predicted) | | color | Light Yellow to Yellow | | BRN | 166360 | | Stability: | Hygroscopic | | InChI | 1S/C9H7N3O2/c10-9-6-2-1-5-11-7(6)3-4-8(9)12(13)14/h1-5H,10H2 | | InChIKey | TYBYHEXFKFLRFT-UHFFFAOYSA-N | | SMILES | Nc1c(ccc2ncccc12)[N+]([O-])=O | | CAS DataBase Reference | 35975-00-9(CAS DataBase Reference) | | NIST Chemistry Reference | 5-Amino-6-nitroquinoline(35975-00-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | PackingGroup | III | | HS Code | 29334990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-Amino-6-nitroquinoline Usage And Synthesis |
| Chemical Properties | ochre-yellow fluffy powder | | Uses | 5-Amino-6-nitroquinoline was used in preparation of imidazoquinoline derivatives. | | General Description | Electrochemical reduction of 5-amino-6-nitroquinoline has been studied at carbon paste electrode by differential pulse voltammetry, direct current voltammetry, adsorptive stripping voltammetry and HPLC with electrochemical detection. |
| | 5-Amino-6-nitroquinoline Preparation Products And Raw materials |
|