|
|
| | (R)-(+)-2-(DIPHENYLMETHYL)PYRROLIDINE Basic information |
| | (R)-(+)-2-(DIPHENYLMETHYL)PYRROLIDINE Chemical Properties |
| Boiling point | 349.6±11.0 °C(Predicted) | | density | 1.062 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.5870(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | pka | 10.68±0.10(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | [α]20/D +3.0°, c = 1% in chloroform | | InChI | InChI=1S/C17H19N/c1-3-8-14(9-4-1)17(16-12-7-13-18-16)15-10-5-2-6-11-15/h1-6,8-11,16-18H,7,12-13H2/t16-/m1/s1 | | InChIKey | OXOBKZZXZVFOBB-MRXNPFEDSA-N | | SMILES | N1CCC[C@@H]1C(C1=CC=CC=C1)C1=CC=CC=C1 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29339900 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (R)-(+)-2-(DIPHENYLMETHYL)PYRROLIDINE Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | Used as excellent chiral solvating agents to determine the enantiomeric composition of chiral carboxylic acids directly by NMR analysis. |
| | (R)-(+)-2-(DIPHENYLMETHYL)PYRROLIDINE Preparation Products And Raw materials |
|