|
|
| | 3-CHLORO-2,4-DIFLUORONITROBENZENE Basic information |
| Product Name: | 3-CHLORO-2,4-DIFLUORONITROBENZENE | | Synonyms: | 3-Chloro-2,4-difluoronitrobenzene 97%, 4-difluoronitrobenzene 97%;3-Chloro-2,4-difluoronitrobenzene 97%;3-Chloro-2,4-difluoronitrobenzene97%;6014 2,4-DIFLUORO-3-CHLORO NITRO BENZENE;2,4-Difluoro-3-chloronitrobnzene;2,4-difluro-3-chloronitrobenzene;2,4-DIFLUORO-3-CHLORONITROBENZENE;2-CHLORO-1,3-DIFLUORO-4-NITRO-BENZENE | | CAS: | 3847-58-3 | | MF: | C6H2ClF2NO2 | | MW: | 193.54 | | EINECS: | 411-980-8 | | Product Categories: | Fluorine series;Aromatic Halides (substituted) | | Mol File: | 3847-58-3.mol |  |
| | 3-CHLORO-2,4-DIFLUORONITROBENZENE Chemical Properties |
| Melting point | 41-43°C | | Boiling point | 243.0±35.0 °C(Predicted) | | density | 1.591±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C6H2ClF2NO2/c7-5-3(8)1-2-4(6(5)9)10(11)12/h1-2H | | InChIKey | CTVBVNKEMCGZDF-UHFFFAOYSA-N | | SMILES | C1(F)=CC=C([N+]([O-])=O)C(F)=C1Cl | | CAS DataBase Reference | 3847-58-3(CAS DataBase Reference) |
| | 3-CHLORO-2,4-DIFLUORONITROBENZENE Usage And Synthesis |
| Chemical Properties | light yellow crystal powde | | Uses | 3-Chloro-2,4-difluoronitrobenzene is a pharmaceutical intermediate, which is reported in the literature to be used for the preparation of LSD1 inhibitors and selective HER2 inhibitors. |
| | 3-CHLORO-2,4-DIFLUORONITROBENZENE Preparation Products And Raw materials |
|