|
|
| | Ethyl 2-(3-oxo-2-piperazinyl)acetate Basic information |
| | Ethyl 2-(3-oxo-2-piperazinyl)acetate Chemical Properties |
| Melting point | 110-111°C | | Boiling point | 360.6±27.0 °C(Predicted) | | density | 1.101±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 15.06±0.40(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H14N2O3/c1-2-13-7(11)5-6-8(12)10-4-3-9-6/h6,9H,2-5H2,1H3,(H,10,12) | | InChIKey | HNYRNJAZRKCHSC-UHFFFAOYSA-N | | SMILES | N1CCNC(=O)C1CC(OCC)=O | | CAS DataBase Reference | 33422-35-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | HazardClass | IRRITANT | | HS Code | 2933599590 |
| | Ethyl 2-(3-oxo-2-piperazinyl)acetate Usage And Synthesis |
| Synthesis | 1. Ethylenediamine (1.17 mL, 17.42 mmol) and diethyl maleate (3 g, 17.42 mmol) were added to a 50 mL round bottom flask and dissolved in propanol (30 mL). 2. The reaction mixture was stirred at 55 °C for 16 h. 3. Upon completion of the reaction, the solvent was removed under reduced pressure by rotary evaporator. 4. The residue was placed in a vacuum drying chamber and The residue was dried to give the crude ethyl 2-(3-oxopiperazin-2-yl)acetate. 5. The crude product was used directly in the next step of the reaction without further purification. Yield: 3.4 g (quantitative yield). | | References | [1] Patent: US2008/312231, 2008, A1. Location in patent: Page/Page column 40
[2] Journal of Heterocyclic Chemistry, 1993, vol. 30, # 1, p. 275 - 276
[3] Journal of Pharmaceutical Sciences, 1990, vol. 79, # 5, p. 447 - 452 |
| | Ethyl 2-(3-oxo-2-piperazinyl)acetate Preparation Products And Raw materials |
|