2-AMINO-5-BROMO-3-METHYLPYRAZINE manufacturers
|
| | 2-AMINO-5-BROMO-3-METHYLPYRAZINE Basic information |
| Product Name: | 2-AMINO-5-BROMO-3-METHYLPYRAZINE | | Synonyms: | 5-BROMO-3-METHYLPYRAZIN-2-YLAMINE;2-AMINO-5-BROMO-3-METHYLPYRAZINE;5-bromo-3-methylpyrazin-2-amine;Pyrazinamine, 5-bromo-3-methyl-;2-Pyrazinamine,5-bromo-3-methyl- | | CAS: | 74290-67-8 | | MF: | C5H6BrN3 | | MW: | 188.03 | | EINECS: | | | Product Categories: | | | Mol File: | 74290-67-8.mol |  |
| | 2-AMINO-5-BROMO-3-METHYLPYRAZINE Chemical Properties |
| Boiling point | 272.4±35.0 °C(Predicted) | | density | 1.699±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 2.00±0.10(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C5H6BrN3/c1-3-5(7)8-2-4(6)9-3/h2H,1H3,(H2,7,8) | | InChIKey | VZZCBPAGRWGQDG-UHFFFAOYSA-N | | SMILES | C1(N)=NC=C(Br)N=C1C |
| | 2-AMINO-5-BROMO-3-METHYLPYRAZINE Usage And Synthesis |
| Synthesis | 1. A chloroform (40 mL) solution of bromine (0.26 mL) was added slowly and dropwise to a stirred chloroform (100 mL) solution of 2-amino-3-methylpyrazine (0.453 g) and pyridine (0.4 mL) under conditions protected from light. The reaction mixture was stirred continuously in sunlight for 1 h. 2. After continuing to stir the reaction mixture for 30 min, it was quenched by addition of water (25 mL). 3. The organic layer was separated and dried with anhydrous magnesium sulfate (MgSO?) followed by evaporation of the solvent under reduced pressure to give a brown oily substance. 4. Purification of the above mentioned oily substance was performed by silica gel column chromatography using dichloromethane as an eluent to give the target compound 2-amino-5 -bromo-3-methylpyrazine as a white solid (0.312 g, 28% yield) with a melting point of 51-52°C. 5. Mass spectrometry analysis (positive ion chemical ionization mode): m/z 188 ([M + H]+). 6. | | References | [1] Journal of Heterocyclic Chemistry, 1980, vol. 17, p. 143 - 147 [2] Patent: US5861401, 1999, A |
| | 2-AMINO-5-BROMO-3-METHYLPYRAZINE Preparation Products And Raw materials |
|