| Chemical Properties | Back Directory | [solubility ]
Soluble in DMSO, DMF, DCM | [form ]
Solid | [color ]
Pink to red | [Appearance]
Dark blue solid | [ex/em]
680/698 nm (PBS buffer) | [ε(extinction coefficient)]
198000 L⋅mol−1⋅cm−1 | [Φ(quantum yield)]
0.20 | [InChIKey]
ZAMUEMBIJDLVQF-UHFFFAOYSA-N | [SMILES]
CC1(C(=[N+](CCCCCC(=O)NCC#C)C2C=CC3=CC=CC=C3C1=2)C=CC=CC=C1N(C2C=CC3=CC=CC=C3C=2C1(C)C)C)C.[Cl-] |
| Hazard Information | Back Directory | [Description]
Cy5.5 alkyne is a cynaine linker containing an alkyne group, which enables Click Chemistry to attach deeply colored and photostable Cyanine5.5 fluorophore to various azide-bearing molecules. Cyanine5.5 is a popular fluorophore that has been widely used for various applications including intact organism imaging. | [Chemical Properties]
Appearance: Dark blue solid ex/em: 680/698 nm (PBS buffer) Extinction coefficient (ε): 198000 L??mol??1??cm??1 Quantum yield (Φ): 0.20 | [Uses]
Cy5.5-Alkyne, is a Fluorescent dye, that can be used for various labeling applications in chemistry.(Abs/Em = 678/694 nm) | [Abs/Em Maxima]
684/710 nm | [Fluoresene quantum yield]
0.2 | [Extinction Coefficient]
198000 | [CF260]
0.07 | [CF280]
0.03 | [Spectrally Similar Dyes]
Alexa Fluor® 680, IRDye® 680RD, DyLight® 680 |
|
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Tel: |
0371-55051623 18137891487 |
| Website: |
https://www.chemicalbook.com/supplier/14555231/ |
|