| Identification | Back Directory | [Name]
4-Methylvaleryl chloride | [CAS]
38136-29-7 | [Synonyms]
Isocaproyl chloride Isocapronyl chloride Methylvaleryl chloride 4-METHYLVALERYL CHLORIDE 4-Methypentanoyl chloride G-METHYLVALEROYL CHLORIDE 4-methyl-pentanoylchlorid 4-METHYLVALEROYL CHLORIDE 4-MethylvalerylChloride> Pentanoyl chloride, 4-methyl- 4-Methylvaleric acid chloride 4-Methylpentanoic acid chloride 4-Methylvaleryl chloride ISO 9001:2015 REACH Iso-Hexanoyl Chloride (Isocapronyl Chloride) | [EINECS(EC#)]
253-801-4 | [Molecular Formula]
C6H11ClO | [MDL Number]
MFCD00018814 | [MOL File]
38136-29-7.mol | [Molecular Weight]
134.6 |
| Chemical Properties | Back Directory | [Boiling point ]
144°C(lit.) | [density ]
0.986±0.06 g/cm3(Predicted) | [refractive index ]
1.4230 to 1.4270 | [form ]
clear liquid | [color ]
Colorless to Light orange to Yellow | [InChI]
InChI=1S/C6H11ClO/c1-5(2)3-4-6(7)8/h5H,3-4H2,1-2H3 | [InChIKey]
SVWCVXFHTHCJJB-UHFFFAOYSA-N | [SMILES]
C(Cl)(=O)CCC(C)C | [EPA Substance Registry System]
Pentanoyl chloride, 4-methyl-(38136-29-7) |
| Hazard Information | Back Directory | [Uses]
4-Methylpentanoyl Chloride is a reagent used in the preparation of novel AKR1C3 inhibitors as potential anti-cancer agents. |
|
|