| Identification | Back Directory | [Name]
3,5-DIHYDROXYFLAVONE | [CAS]
6665-69-6 | [Synonyms]
3,5-DIHYDROXYFLAVONE
4H-1-Benzopyran-4-one, 3,5-dihydroxy-2-phenyl- | [Molecular Formula]
C15H10O4 | [MDL Number]
MFCD00143074 | [MOL File]
6665-69-6.mol | [Molecular Weight]
254.24 |
| Chemical Properties | Back Directory | [Melting point ]
145-146 °C | [Boiling point ]
451.8±45.0 °C(Predicted) | [density ]
1.472±0.06 g/cm3(Predicted) | [form ]
solid | [pka]
6.58±0.40(Predicted) | [InChI]
1S/C15H10O4/c16-10-5-9(6-11(17)7-10)15-8-13(18)12-3-1-2-4-14(12)19-15/h1-8,16-17H | [InChIKey]
MCCZLKPPEPSZAU-UHFFFAOYSA-N | [SMILES]
Oc1cc(O)cc(c1)C2=CC(=O)c3ccccc3O2 |
| Hazard Information | Back Directory | [Uses]
3,5-Dihydroxyflavone (CAS# 6665-69-6) is a flavenoid which, as a class of compounds, have broad pharmacological activity, including binding to biomolecules such as enzymes, hormone carriers, and DNA, chelating transition metal ions, catalyzing electron transport, and scavenging free radicals. |
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Carbosynth
|
| Tel: |
+86 512 6260 5585 |
| Website: |
www.carbosynth.com |
| Company Name: |
Leancare Ltd.
|
| Tel: |
+33 962096793 |
| Website: |
www.leancare.co.uk |
|