| Identification | Back Directory | [Name]
(S)-(-)-2-(TRIFLUOROACETAMIDO)SUCCINIC ANHYDRIDE | [CAS]
777-33-3 | [Synonyms]
TFA-L-ASPARTIC ACID ANHYDRIDE N-TRIFLUOROACETYL-L-ASPARTIC ANHYDRIDE (S)-2-TRIFLUOROACETAMIDESUCCINIC ANHYDRIDE N-TRIFLUOROACETYL-L-ASPARTIC ACID ANHYDRIDE (S)-(-)-2-(TRIFLUOROACETAMIDO)SUCCINIC ANHYDRIDE N-(2,5-DIOXOOXOLAN-3-YL)-2,2,2-TRIFLUOROACETAMIDE (S)-(-)-2-(TrifluoroacetaMido)succinic anhydride 97% N-[(3S)-2,5-dioxooxolan-3-yl]-2,2,2-trifluoroacetamide (S)-N-(2,5-dioxotetrahydrofuran-3-yl)-2,2,2-trifluoroacetamide N-[(3S)-2,5-Dioxotetrahydro-3-furanyl]-2,2,2-trifluoroacetamide Acetamide, 2,2,2-trifluoro-N-[(3S)-tetrahydro-2,5-dioxo-3-furanyl]- (S)-(-)-2-(trifluoroacetamido)succinic anhydride, N-trifluoroacetyl aspartic anhydride (S)-(-)-2-Trifluoroacetamidosuccinic anhydride, N-Trifluoroacetyl-L-aspartic acid anhydride | [Molecular Formula]
C6H4F3NO4 | [MDL Number]
MFCD00012332 | [MOL File]
777-33-3.mol | [Molecular Weight]
211.1 |
| Chemical Properties | Back Directory | [Melting point ]
131-132 °C (lit.) | [Boiling point ]
379.2±42.0 °C(Predicted) | [density ]
1.60±0.1 g/cm3(Predicted) | [storage temp. ]
2-8°C | [form ]
solid | [pka]
8?+-.0.20(Predicted) | [Optical Rotation]
[α]20/D 28.0°, c = 1 in THF | [InChI]
1S/C6H4F3NO4/c7-6(8,9)5(13)10-2-1-3(11)14-4(2)12/h2H,1H2,(H,10,13)/t2-/m0/s1 | [InChIKey]
ABTJOHYOWBAGTP-REOHCLBHSA-N | [SMILES]
FC(F)(F)C(=O)N[C@H]1CC(=O)OC1=O |
| Safety Data | Back Directory | [Hazard Codes ]
T | [Risk Statements ]
25 | [Safety Statements ]
36-45 | [RIDADR ]
UN 2811 6.1/PG 3 | [WGK Germany ]
3 | [Storage Class]
6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | [Hazard Classifications]
Acute Tox. 2 Oral |
| Hazard Information | Back Directory | [Uses]
Useful in the synthesis of 2-amino-6,7-dihydroxy-1,2,3,4-tetrahydronaphthalene, a potent dopamine agonist. Used in the synthesis of sweetening agents, such as N-trifluoroacetyl-L-aspartic acid α-amides and α-anilides. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
ytxinnuoguijiao
|
| Tel: |
15615652679 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList818950/0_EN.htm |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|