| Identification | Back Directory | [Name]
3-(4-METHYLPHENOXY)BENZALDEHYDE | [CAS]
79124-75-7 | [Synonyms]
Einecs 279-068-0 3-(P-TOLYLOXY)BENZALDEHYDE 3-(p-methylphenoxy)benzaldehyde 3-(4-METHYLPHENOXY)BENZALDEHYDE 3-(4-Methylphenoxy)benzaldehyde 97% | [EINECS(EC#)]
279-068-0 | [Molecular Formula]
C14H12O2 | [MDL Number]
MFCD00003360 | [MOL File]
79124-75-7.mol | [Molecular Weight]
212.24 |
| Chemical Properties | Back Directory | [Boiling point ]
140 °C2 mm Hg(lit.)
| [density ]
1.102 g/mL at 25 °C(lit.)
| [refractive index ]
n20/D 1.59(lit.)
| [Fp ]
>230 °F
| [InChI]
1S/C14H12O2/c1-11-5-7-13(8-6-11)16-14-4-2-3-12(9-14)10-15/h2-10H,1H3 | [InChIKey]
ASKLCRGXIJGVOY-UHFFFAOYSA-N | [SMILES]
Cc1ccc(Oc2cccc(C=O)c2)cc1 |
| Hazard Information | Back Directory | [Uses]
3-(4-Methylphenoxy)benzaldehyde was used in the synthesis of benzoxazole derivatives of the mannopeptimycin glycopeptide antibiotics. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|