| Identification | Back Directory | [Name]
3,6,9,12,15,18,21,24-Octaoxahexacosane-1,26-diamine | [CAS]
82209-36-7 | [Synonyms]
NH2-PEG8-NH2 H2N-dPEG8-CH2CH2NH2 3,6,9,12,15,18,21,24-Octaoxahexacosane-1,26-diamine 1,26-Diamino-3,6,9,12,15,18,21,24-octaoxahexacosane | [Molecular Formula]
C18H40N2O8 | [MDL Number]
MFCD28122964 | [MOL File]
82209-36-7.mol | [Molecular Weight]
412.52 |
| Chemical Properties | Back Directory | [storage temp. ]
-20°C | [solubility ]
Soluble in Water, DMSO, DCM, DMF | [form ]
Liquid | [color ]
Colorless to light yellow | [InChI]
InChI=1S/C18H40N2O8/c19-1-3-21-5-7-23-9-11-25-13-15-27-17-18-28-16-14-26-12-10-24-8-6-22-4-2-20/h1-20H2 | [InChIKey]
QNNWDQWXZAXENQ-UHFFFAOYSA-N | [SMILES]
C(N)COCCOCCOCCOCCOCCOCCOCCOCCN |
| Hazard Information | Back Directory | [Description]
Amino-PEG8-Amine is a conjugation linker containing two amine (NH2) groups. The hydrophilic PEG spacer increases solubility in aqueous media. The amino groups are reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. | [Uses]
Applications may include: bioconjugation, drug delivery, PEG hydrogel, crosslinker, and surface functionalization | [General Description]
Amino-PEG8-amine (CAS 82209-36-7), also known as H₂N-PEG8-CH₂CH₂NH₂ and NH₂-PEG8-NH₂,
is a high-purity, symmetrical, homobifunctional, discrete PEG linker. Its molecular weight is 412.52. It is soluble in water, DMSO, DCM and DMF. At room temperature, it is typically a pale yellow to colourless viscous liquid or a low-melting-point waxy solid. | [References]
[1] Mathieu L Lepage. (2015). Design, synthesis and photochemical properties of the first examples of iminosugar clusters based on fluorescent cores. ACS Applied Bio Materials, 659–667. https://doi.org/10.3762/bjoc.11.74 |
|
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Nextpeptide Inc
|
| Telephone: |
+86-0571-81612335 +8613336028439 |
| Website: |
http://www.nextpeptide.com/ |
|