| Identification | Back Directory | [Name]
HS-PEG8-CH2CH2COOH | [CAS]
866889-02-3 | [Synonyms]
SH-PEG8-COOH Thio-PEG8-acid Thiol-PEG8-acid HS-PEG8-CH2CH2COOH Thiol-PEG8-propionic acid HS-PEG8-CH2CH2COOH 4,7,10,13,16,19,22,25-Octaoxaheptacosanoicacid, 27-mercapto- 1-Mercapto-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oic acid O-(2-Carboxyethyl)-O'-(2-Mercaptoethyl)heptaethylene glycol >=95% (oligoMer purity) | [Molecular Formula]
C19H38O10S | [MDL Number]
MFCD08705300 | [MOL File]
866889-02-3.mol | [Molecular Weight]
458.56 |
| Chemical Properties | Back Directory | [Boiling point ]
559.7±50.0 °C(Predicted) | [density ]
1.141±0.06 g/cm3(Predicted) | [storage temp. ]
-20°C | [form ]
Liquid | [pka]
4.28±0.10(Predicted) | [color ]
Colorless to light yellow | [InChI]
1S/C19H38O10S/c20-19(21)1-2-22-3-4-23-5-6-24-7-8-25-9-10-26-11-12-27-13-14-28-15-16-29-17-18-30/h30H,1-18H2,(H,20,21) | [InChIKey]
SKYJRDAORYSCAL-UHFFFAOYSA-N | [SMILES]
OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCS |
| Hazard Information | Back Directory | [Description]
Thiol-PEG8-acid is a PEG linker containing a thiol group and a terminal carboxylic acid. The hydrophilic PEG spacer increases solubility in aqueous media. The thiol group reacts with maleimide, OPSS, vinylsulfone and transition metal surfaces including gold, silver, etc. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | [Uses]
O-(2-Carboxyethyl)-O′-(2-mercaptoethyl)heptaethylene glycol can be used:
- To prepare near-infrared fluorochromes applicable in imaging techniques.
- To functionalize Au nanoparticles for optoelectronic applications.
- As a linker in the synthesis of antibody-functionalized Au nanoparticles for forensic applications.
| [reaction suitability]
reagent type: cross-linking reagent | [IC 50]
PEGs |
|
| Company Name: |
ChemPep, Inc.
|
| Tel: |
+1 (888) 615-9178 / (561) 791-8787 |
| Website: |
www.chempep.com |
| Company Name: |
T&W GROUP
|
| Tel: |
021-61551611 13296011611 |
| Website: |
www.trustwe.com/ |
|