| Identification | Back Directory | [Name]
2,2,6,6-Tetramethylpiperidinylmagnesium chloride lithium chloride complex | [CAS]
898838-07-8 | [Synonyms]
piperidinyL 2,2,6,6-tetramethylpiperidin-1-ide 2,2,6,6-Tetramethylpiperidinylmagnesium chloride l 2,2,6,6-Tetramethylpiperidinylmagnesium chloride lithium chl Dichloro(2,2,6,6-tetramethylpiperidinato)magnesate(1-) lithium lithium,magnesium,2,2,6,6-tetramethylpiperidin-1-ide,dichloride 2,2,6,6-Tetramethylpiperidinylmagnesium chloride lithium chloride Dichloro(2,2,6,6-tetramethylpiperidinato)magnesate(1-) lithium (1:1) Magnesate(1-), dichloro(2,2,6,6-tetramethylpiperidinato)-, lithium (1:1) 2,2,6,6-Tetramethylpiperidinylmagnesium chloride lithium chloride complex 2,2,6,6-TETRAMETHYLPIEPERIDINYL MAGNESIUM CHLORIDE, LITHIUM CHLORIDE COMPLEX 2,2,6,6-Tetramethyl piperidinyl Mag Chloride Lithium Chloride complex 1.M in THF 2,2,6,6-Tetramethylpiperidinylmagnesium chloride lithium chloride complex solution 2,2,6,6-TETRAMETHYLPIEPERIDINYL MAGNESIUM CHLORIDE, LITHIUM CHLORIDE COMPLEX 1.0 M in THF 2,2,6,6-Tetramethylpiperidinylmagnesium chloride lithium chloride complex 1.0 M solution in THF 2,2,6,6-Tetramethylpiperidinylmagnesium chloride lithium chloride complex solution, 1.0 M in THF 2,2,6,6-TetraMethylpiperidinylMagnesiuM chloride lithiuM chloride coMplex solution 1.0 M in THF/toluene | [Molecular Formula]
C9H18Cl2LiMgN | [MDL Number]
MFCD12546030 | [MOL File]
898838-07-8.mol | [Molecular Weight]
242.4 |
| Chemical Properties | Back Directory | [Boiling point ]
66°/759.8mm | [density ]
0.96g/mLat 25℃ | [Fp ]
-15°C | [storage temp. ]
2-8°C | [form ]
liquid | [InChI]
InChI=1S/C9H18N.2ClH.Li.Mg/c1-8(2)6-5-7-9(3,4)10-8;;;;/h5-7H2,1-4H3;2*1H;;/q-1;;;+1;+2/p-2 | [InChIKey]
JHBZAAACZVPPRQ-UHFFFAOYSA-L | [SMILES]
[Mg+2]([N-]1C(CCCC1(C)C)(C)C)([Cl-])[Cl-].[Li+] |
| Hazard Information | Back Directory | [Uses]
2,2,6,6-Tetramethylpiperidinylmagnesium chloride lithium chloride complex deprotonations using Knochel-Hauser-Base
| [reaction suitability]
reaction type: Grignard Reaction | [Synthesis]
A 1000-ml triple-necked flask was taken, and the reaction flask was replaced three times with argon, and a little argon was turned on after the replacement so that the triple-necked flask was in an argon atmosphere, and then anhydrous lithium chloride (42 |
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Jia Xing Isenchem Co.,Ltd
|
| Telephone: |
0573-85285100 18627885956 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList14265/0_EN.htm |
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Infinity SCI
|
| Telephone: |
400-106-2016 17800804092 |
| Website: |
http://www.infsci.com |
|