| Identification | Back Directory | [Name]
Uridine Diphosphate Choline | [CAS]
99492-83-8 | [Synonyms]
UDP-choline Uridine Diphosphate Choline Uridine 5-?diphosphate choline Uridine Diphosphate Choline (UDPC) Uridine 5'-diphosphate choline ammonium salt Uridine Impurity 11 (Uridine Diphosphate Choline)(UDPC) Uridine 5'-?diphosphate choline
DISCONTINUED. Please see U829930. Uridine 5'-(Trihydrogen Diphosphate) P'-[2-(TriMethylaMMonio)ethyl] Ester Inner Salt [[(2R,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] 2-(trimethylazaniumyl)ethyl phosphate Uridine Diphosphate Choline (UDPC)Q: What is
Uridine Diphosphate Choline (UDPC) Q: What is the CAS Number of
Uridine Diphosphate Choline (UDPC) Q: What is the storage condition of
Uridine Diphosphate Choline (UDPC) Q: What are the applications of
Uridine Diphosphate Choline (UDPC) | [Molecular Formula]
C14H25N3O12P2 | [MOL File]
99492-83-8.mol | [Molecular Weight]
508 |
| Chemical Properties | Back Directory | [solubility ]
DMSO (Slightly, Heated, Sonicated), Methanol (Slightly, Heated), Water (Slightly) | [form ]
Solid | [color ]
White to Dark Yellow | [Stability:]
Very Hygroscopic | [InChIKey]
QXRGZHKAEBNXGI-INIVMZOFNA-N | [SMILES]
C(OP(OP(O)(O)=O)(O)=O)[C@H]1O[C@@H](N2C=CC(=O)NC2=O)[C@H](O)[C@@H]1O.OCC[N+](C)(C)C |&1:10,12,21,23,r| |
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Telephone: |
18210857532 18210857532 |
| Website: |
https://www.jkchemical.com |
| Company Name: |
TOSUN PHARM
|
| Telephone: |
020-66392521-118 18922260391 |
| Website: |
www.toref.cn/ |
| Company Name: |
NewCan Biotech Limited
|
| Telephone: |
+86-571-86912261 19975279805 |
| Website: |
https://www.newcanbio.com/ |
| Company Name: |
sgtlifesciences pvt ltd
|
| Telephone: |
+91-8790379245 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList1846349/0.htm |
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
|