|
|
| | 4-Boc-3(R)-morpholinecarboxylic acid Basic information |
| | 4-Boc-3(R)-morpholinecarboxylic acid Chemical Properties |
| Melting point | 181℃ | | Boiling point | 369.5±42.0 °C(Predicted) | | density | 1.230±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 3.53±0.20(Predicted) | | form | Powder | | color | White | | Optical Rotation | Consistent with structure | | InChI | InChI=1S/C10H17NO5/c1-10(2,3)16-9(14)11-4-5-15-6-7(11)8(12)13/h7H,4-6H2,1-3H3,(H,12,13)/t7-/m1/s1 | | InChIKey | KVXXEKIGMOEPSA-SSDOTTSWSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCOC[C@@H]1C(O)=O | | CAS DataBase Reference | 869681-70-9 |
| RIDADR | UN2811 | | HazardClass | 6.1 | | HS Code | 2934999090 |
| | 4-Boc-3(R)-morpholinecarboxylic acid Usage And Synthesis |
| Chemical Properties | White to off-white crystalline | | Uses | 4-Boc-3(R)-morpholinecarboxylic acid is an organic compound, which is mainly used as a pharmaceutical intermediate, especially as an important starting reactant and key intermediate in peptide synthesis. |
| | 4-Boc-3(R)-morpholinecarboxylic acid Preparation Products And Raw materials |
|