- 4-Chloro-2-fluoroaniline
-
- $2.00 / 100KG
-
2026-04-17
- CAS:57946-56-2
- Min. Order: 0.1KG
- Purity: 99%
- Supply Ability: g-kg-tons
|
| | 4-Chloro-2-fluoroaniline Basic information |
| | 4-Chloro-2-fluoroaniline Chemical Properties |
| Boiling point | 104-107 °C (28 mmHg) | | density | 1.311 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.56(lit.) | | Fp | 210 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 2.57±0.10(Predicted) | | form | Liquid | | Specific Gravity | 1.311 | | color | Clear slightly yellow to orange-brown | | Water Solubility | slightly soluble | | BRN | 1934804 | | InChI | InChI=1S/C6H5ClFN/c7-4-1-2-6(9)5(8)3-4/h1-3H,9H2 | | InChIKey | CSFDTBRRIBJILD-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(Cl)C=C1F | | CAS DataBase Reference | 57946-56-2(CAS DataBase Reference) |
| Hazard Codes | Xn,T,Xi | | Risk Statements | 20/21/22-36/37/38-23/24/25 | | Safety Statements | 26-37/39-36/37/39-45 | | RIDADR | 2810 | | WGK Germany | 3 | | Hazard Note | Toxic | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29214200 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-Chloro-2-fluoroaniline Usage And Synthesis |
| Chemical Properties | clear slightly yellow to orange-brown liquid | | Uses | 4-Chloro-2-fluoroaniline is a compound used in the synthesis of 4-Chloro-2-fluoro-3-iodobenzenamine (1000590-87-3). |
| | 4-Chloro-2-fluoroaniline Preparation Products And Raw materials |
|