| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Boc-O-dibenzylphospho-L-serine manufacturers
|
| | Boc-O-dibenzylphospho-L-serine Basic information |
| Product Name: | Boc-O-dibenzylphospho-L-serine | | Synonyms: | N-ALPHA-BOC-O-(DIBENZYLPHOSPHO)-L-SERINE;BOC-SER(PO3BZL2)-OH;nα-boc-o-(dibenzylphospho)-l-serine;11-Mercaptoundecanoic acid,MUA, MUDA;N^a-Boc-O-(dibenzylphospho)-L-serine, 96%;(S)-3-((Bis(benzyloxy)phosphoryl)oxy)-2-((tert-butoxycarbonyl)amino)propanoic acid;Boc-L-Ser(PO3Bzl2)-OH;Boc-O-dibenzylphospho-L-serine98+% | | CAS: | 90013-45-9 | | MF: | C22H28NO8P | | MW: | 465.43 | | EINECS: | | | Product Categories: | | | Mol File: | 90013-45-9.mol |  |
| | Boc-O-dibenzylphospho-L-serine Chemical Properties |
| Melting point | 85-86 °C | | Boiling point | 626.9±55.0 °C(Predicted) | | density | 1.273±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 3.17±0.10(Predicted) | | color | yellow | | BRN | 4278166 | | Major Application | peptide synthesis | | InChIKey | KZUUIAQQHXTYFI-IBGZPJMESA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](COP(=O)(OCc1ccccc1)OCc2ccccc2)C(O)=O | | CAS DataBase Reference | 90013-45-9 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Boc-O-dibenzylphospho-L-serine Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-O-dibenzylphospho-L-serine Preparation Products And Raw materials |
|