5,6-Difluoroindole-2-carboxylic acid manufacturers
|
| | 5,6-Difluoroindole-2-carboxylic acid Basic information |
| | 5,6-Difluoroindole-2-carboxylic acid Chemical Properties |
| Boiling point | 427.4±40.0 °C(Predicted) | | density | 1.605±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 4.21±0.30(Predicted) | | form | solid | | color | Pale brown | | Sensitive | Light Sensitive | | InChI | InChI=1S/C9H5F2NO2/c10-5-1-4-2-8(9(13)14)12-7(4)3-6(5)11/h1-3,12H,(H,13,14) | | InChIKey | XBVUJSXNSDFADV-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(F)C(F)=C2)C=C1C(O)=O | | CAS DataBase Reference | 169674-35-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | WGK 3 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids |
| | 5,6-Difluoroindole-2-carboxylic acid Usage And Synthesis |
| | 5,6-Difluoroindole-2-carboxylic acid Preparation Products And Raw materials |
|