3,3-Dimethylallylboronic acid pinacol ester, 2-(3-Methyl-but-2-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane manufacturers
|
| | 3,3-Dimethylallylboronic acid pinacol ester, 2-(3-Methyl-but-2-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Basic information |
| Product Name: | 3,3-Dimethylallylboronic acid pinacol ester, 2-(3-Methyl-but-2-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | | Synonyms: | 3,3-Dimethylallylboronic acid pinacol ester, 2-(3-Methyl-but-2-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;3-Methyl-2-butenylboronic acid pinacol ester;2-(3-Methyl-but-2-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;3-Methyl-2-butenylboronic acid pinacol ester 96%;3-Methylbut-2-enylboronic acid, pinacol ester;4,4,5,5-Tetramethyl-2-(3-methyl-2-buten-1-yl)-1,3,2-dioxaborolane;4,4,5,5-Tetramethyl-2-(3-methylbut-2-en-1-yl)-1,3,2-dioxaborolane;4,4,5,5-tetraMethyl-2-(3-Methylbut-2-enyl)-1,3,2-dioxaborolane | | CAS: | 141550-13-2 | | MF: | C11H21BO2 | | MW: | 196.09 | | EINECS: | | | Product Categories: | | | Mol File: | 141550-13-2.mol |  |
| | 3,3-Dimethylallylboronic acid pinacol ester, 2-(3-Methyl-but-2-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Chemical Properties |
| Boiling point | 42-45 °C/0.6 mmHg | | density | 0.885 g/mL at 25 °C | | refractive index | n20/D 1.4395 | | Fp | 77 °C | | storage temp. | 2-8°C | | form | liquid | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C11H21BO2/c1-9(2)7-8-12-13-10(3,4)11(5,6)14-12/h7H,8H2,1-6H3 | | InChIKey | QXDMQRNIDKVRCN-UHFFFAOYSA-N | | SMILES | C\C(C)=C\CB1OC(C)(C)C(C)(C)O1 |
| RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 10 - Combustible liquids |
| | 3,3-Dimethylallylboronic acid pinacol ester, 2-(3-Methyl-but-2-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Usage And Synthesis |
| | 3,3-Dimethylallylboronic acid pinacol ester, 2-(3-Methyl-but-2-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Preparation Products And Raw materials |
|