| Company Name: |
LGM Pharma |
| Tel: |
1-(800)-881-8210 |
| Email: |
inquiries@lgmpharma.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
- Denopamine
-
- $2220.00
-
2026-05-11
- CAS:71771-90-9
- Purity:
- Supply Ability: 10g
- r(-)-denopamine
-
- $1.00
-
2020-02-05
- CAS:71771-90-9
- Min. Order: 1KG
- Purity: Min98% HPLC
|
| | R(-)-denopamine Basic information |
| Product Name: | R(-)-denopamine | | Synonyms: | (-)-(r)-1-(p-hydroxyphenyl)-2-((3,4-dimethoxyphenethyl)amino)ethanol;alpha-(((2-(3,4-dimethoxyphenyl)ethyl)amino)methyl)-4-hydroxy-benzenemethano;kalgut;(-)-α-(3,4-dimethoxyphenethylaminomethyl)-4-hydroxy-benzyl-alcohol;Benzenemethanol, α-[[[2-(3,4-dimethoxyphenyl)ethyl]amino]methyl]-4-hydroxy-, (R)-;Benzenemethanol, α-[[[2-(3,4-dimethoxyphenyl)ethyl]amino]methyl]-4-hydroxy-, (αR)-;Carguto;TA 064 | | CAS: | 71771-90-9 | | MF: | C18H23NO4 | | MW: | 317.38 | | EINECS: | | | Product Categories: | | | Mol File: | 71771-90-9.mol |  |
| | R(-)-denopamine Chemical Properties |
| Melting point | 135°C | | Boiling point | 456.67°C (rough estimate) | | density | 1.1949 (rough estimate) | | refractive index | 1.5740 (estimate) | | storage temp. | 2-8°C | | solubility | DMSO: 26 mg/mL, soluble | | form | powder | | pka | 9.97±0.26(Predicted) | | color | white | | InChI | 1S/C18H23NO4/c1-22-17-8-3-13(11-18(17)23-2)9-10-19-12-16(21)14-4-6-15(20)7-5-14/h3-8,11,16,19-21H,9-10,12H2,1-2H3/t16-/m0/s1 | | InChIKey | VHSBBVZJABQOSG-INIZCTEOSA-N | | SMILES | COc1ccc(CCNC[C@H](O)c2ccc(O)cc2)cc1OC |
| Hazard Codes | Xn | | Risk Statements | 62-63 | | Safety Statements | 22-36/37/39-45 | | WGK Germany | 3 | | RTECS | DA4795470 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Repr. 2 |
| | R(-)-denopamine Usage And Synthesis |
| Description | Denopamine is a potent orally-active cardiotonic with selective effects on the beta,
adrenergic receptors. Unlike isoproterenol or dobutamine, denopamine’s positive
inotropic activity is not mediated through the release of catecholamines; its lack of effect
on heart rate and myocardial oxygen consumption thus offers significant advantages in the
management of congestive heart failure. | | Chemical Properties | L-hydrochloride: C18H23NO4·HCl. Crystallizes from isopropanol, melting point 138-139.5°C. [α]D23-38° (C=1, methanol). DL-hydrochloride: C18H23NO4·HCl. Crystallizes from isopropanol-isopropyl ether, melting point 164-167°C. | | Originator | Tanabe Seiyaku (Japan) | | Uses | R(-)-Denopamine has been used as an β-adrenergic agonist to study its effects on contractility in isolated lymphatic vessels (LVs). | | Definition | ChEBI: Denopamine is a dimethoxybenzene. | | Brand name | Kalgut | | Biochem/physiol Actions | Denopamine is a cardiotonic drug. |
| | R(-)-denopamine Preparation Products And Raw materials |
|