| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | D-(-)-2-Chlorophenylglycine methyl ester HCl Basic information |
| Product Name: | D-(-)-2-Chlorophenylglycine methyl ester HCl | | Synonyms: | D-(-)-2-Chlorophenylglycine methyl ester hydrochloride;(R)-Methyl 2-aMino-2-(2-chlorophenyl)acetate hydrochloride;R-2-Chlorophenylglycine methyl ester hydrochloride (1:1);Clopidogrel Impurity 2;Clopidogrel Impurity 5 HCl;methyl (2R)-2-amino-2-(2-chlorophenyl)acetate;(R)-(-)-2-Chlorophenylglycine methyl ester hcl;methyl (R)-2-amino-2-(2-chlorophenyl)acetate hydrochloride | | CAS: | 212838-70-5 | | MF: | C9H10ClNO2.ClH | | MW: | 236.1 | | EINECS: | 1308068-626-2 | | Product Categories: | | | Mol File: | 212838-70-5.mol |  |
| | D-(-)-2-Chlorophenylglycine methyl ester HCl Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | solubility | Acetonitrile (Slightly), Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Major Application | pharmaceutical | | InChI | InChI=1/C9H10ClNO2.ClH/c1-13-9(12)8(11)6-4-2-3-5-7(6)10;/h2-5,8H,11H2,1H3;1H/t8-;/s3 | | InChIKey | SUUNIMMHDPICBD-JNODIIHCNA-N | | SMILES | C1(C=CC=CC=1Cl)[C@@H](N)C(OC)=O.Cl |&1:7,r| |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | D-(-)-2-Chlorophenylglycine methyl ester HCl Usage And Synthesis |
| Uses | These Reference Materials are suitable for use in several analytical applications including, but not limited to, method development for qualitative and quantitative analyses, daily calibration, and routine quality control testing. |
| | D-(-)-2-Chlorophenylglycine methyl ester HCl Preparation Products And Raw materials |
|