|
|
| | Nonafluorohexyltrimethoxysilane Basic information |
| Product Name: | Nonafluorohexyltrimethoxysilane | | Synonyms: | TriMethoxy(1H,1H,2H,2H-nonafluorohexyl)silane;Nonafluorobutylethyltrimethoxysilane;Nonafluoro-1,1,2,2-tetrahydrohexyltrimethoxysilane;Dow Corning B 3958;3,3,4,4,5,5,6,6,6-Nonafluorohexyltrimethoxysilane;(1,1,2,2-Tetrahydrononafluorohexyl)trimethoxysilane;Trimethoxy(1H,1H,2H,2H-nonafluorohexyl)silane;triMethoxy(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane | | CAS: | 85877-79-8 | | MF: | C9H13F9O3Si | | MW: | 368.27 | | EINECS: | 248-418-4 | | Product Categories: | | | Mol File: | 85877-79-8.mol |  |
| | Nonafluorohexyltrimethoxysilane Chemical Properties |
| Boiling point | 68-9°C/15mmHg | | density | 1,335 g/cm3 | | refractive index | 1.3376 | | Fp | 71°C(lit.) | | storage temp. | Storage temp. 2-8°C | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 1.335 | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | InChI=1S/C9H13F9O3Si/c1-19-22(20-2,21-3)5-4-6(10,11)7(12,13)8(14,15)9(16,17)18/h4-5H2,1-3H3 | | InChIKey | IJROHELDTBDTPH-UHFFFAOYSA-N | | SMILES | [Si](OC)(OC)(OC)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | EPA Substance Registry System | ((Perfluorobutyl)ethyl)trimethoxysilane (85877-79-8) |
| TSCA | No | | HS Code | 2931.90.9010 |
| | Nonafluorohexyltrimethoxysilane Usage And Synthesis |
| Uses | Non-fluorohexyltrimethoxysilane (NFTOS) is used as a weakly coordinating additive to enhance the compatibility between phosphate-based solvents and sodium metal anodes. NFTOS exhibits super-wetting properties on alkali metal anodes, effectively reducing the contact angle between the electrolyte and the sodium anode (from 49.3° to 38.6°), thereby enabling the electrolyte to better wet and penetrate the electrode surface. By improving wettability, NFTOS helps to form a more uniform and dense inorganic solid electrolyte interphase (SEI) film on the sodium anode surface, which contributes to enhancing the battery's cycling stability and safety[1]. | | References | [1] Song, X., Liang, X., Kim, M., & Sun, Y. (2025). Customized Solvation Structure for Stable and Safe Sodium‐Metal Batteries. Advanced Energy Materials, 81 1. https://doi.org/10.1002/aenm.202504683 |
| | Nonafluorohexyltrimethoxysilane Preparation Products And Raw materials |
|