ALPHA,ALPHA,2,4-TETRACHLOROTOLUENE manufacturers
|
| | ALPHA,ALPHA,2,4-TETRACHLOROTOLUENE Basic information |
| Product Name: | ALPHA,ALPHA,2,4-TETRACHLOROTOLUENE | | Synonyms: | ALPHA,ALPHA,2,4-TETRACHLOROTOLUENE;α,α,2,4-Tetrachlorotoluene;2,4-dichloro-1-(dichloromethyl)benzene;2,4-Dichlorobenzalchloride;2,4-Dichlorobenzyl dichloride;Benzene,2,4-dichloro-1-(dichloromethyl)-;Nintedanib Impurity 100 | | CAS: | 134-25-8 | | MF: | C7H4Cl4 | | MW: | 229.92 | | EINECS: | 205-134-5 | | Product Categories: | | | Mol File: | 134-25-8.mol |  |
| | ALPHA,ALPHA,2,4-TETRACHLOROTOLUENE Chemical Properties |
| Boiling point | 110-115℃ (1 Torr) | | density | 1.501±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | InChI | InChI=1S/C7H4Cl4/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,7H | | InChIKey | AQVKVGOTPBBVMS-UHFFFAOYSA-N | | SMILES | C1(C(Cl)Cl)=CC=C(Cl)C=C1Cl | | CAS DataBase Reference | 134-25-8 | | EPA Substance Registry System | Benzene, 2,4-dichloro-1-(dichloromethyl)- (134-25-8) |
| TSCA | TSCA listed | | HS Code | 2903998089 |
| | ALPHA,ALPHA,2,4-TETRACHLOROTOLUENE Usage And Synthesis |
| Chemical Properties | 2,4-Dichloro-1-(dichloromethyl)benzene is a white solid, mp42℃, bp118～120℃/1.86kpa, soluble in organic solvents such as benzene, ether and ketone. | | Uses | 2,4-Dichloro-1-(dichloromethyl)benzene is an intermediate for the preparation of 2,4-dichlorobenzaldehyde, which can be used for the production of fungicides such as diconazole. | | Synthesis | 2,4-dichlorotoluene and a small amount of PCl3 are used as catalysts, and chlorine gas is introduced to react, and finally 2,4-Dichloro-1-(dichloromethyl)benzene can be obtained. |
| | ALPHA,ALPHA,2,4-TETRACHLOROTOLUENE Preparation Products And Raw materials |
|