|
|
| | 3,5-Di-tert-butyl-4-hydroxybenzoic acid Basic information |
| Product Name: | 3,5-Di-tert-butyl-4-hydroxybenzoic acid | | Synonyms: | 4-HYDROXY-3,5-DITERTBUTYL BENZOIC ACID;3,5-DI-TERT-BUTYL-4-HYDROXYBENZOIC ACID;3,5-Bis-tert-butyl-4-hydroxybenzoic acid;2,6-Di-tert-butyl-4-carboxyphenol;-Carboxy-2,6-di-tert-butylphenol;4-Carboxy-2,6-di-tert-butylphenol;3,5-Di-tert-butyl-4-hydroxybenzoic acid,99%;3,5-tert butyl -4- hydroxybenzoic acid | | CAS: | 1421-49-4 | | MF: | C15H22O3 | | MW: | 250.33 | | EINECS: | 215-823-2 | | Product Categories: | C13 to C42+;Carbonyl Compounds;Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;Organic acids;Carboxylic Acids;Pharmaceutical Intermediate;Phenyls & Phenyl-Het | | Mol File: | 1421-49-4.mol |  |
| | 3,5-Di-tert-butyl-4-hydroxybenzoic acid Chemical Properties |
| Melting point | 206-209 °C (lit.) | | Boiling point | 353.47°C (rough estimate) | | density | 1.0589 (rough estimate) | | refractive index | 1.5600 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.77±0.10(Predicted) | | color | White to Pale Yellow | | Water Solubility | Insoluble in water. | | BRN | 2216948 | | Stability: | Hygroscopic | | InChI | 1S/C15H22O3/c1-14(2,3)10-7-9(13(17)18)8-11(12(10)16)15(4,5)6/h7-8,16H,1-6H3,(H,17,18) | | InChIKey | YEXOWHQZWLCHHD-UHFFFAOYSA-N | | SMILES | CC(C)(C)c1cc(cc(c1O)C(C)(C)C)C(O)=O | | CAS DataBase Reference | 1421-49-4(CAS DataBase Reference) | | NIST Chemistry Reference | Benzoic acid, 3,5-bis(1,1-dimethylethyl)-4-hydroxy-(1421-49-4) | | EPA Substance Registry System | Benzoic acid, 3,5-bis(1,1-dimethylethyl)-4-hydroxy- (1421-49-4) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | DG6320000 | | TSCA | TSCA listed | | HS Code | 29181990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3,5-Di-tert-butyl-4-hydroxybenzoic acid Usage And Synthesis |
| Chemical Properties | Light yellow to beige crystalline powder | | Uses | 3,5-Di-tert-butyl-4-hydroxybenzoic acid was used in the synthesis of antistress agents. It is used as pharmaceutical intermediates. | | General Description | 3,5-Di-tert-butyl-4-hydroxybenzoic acid is a metabolite of butylated hydroxytoluene. |
| | 3,5-Di-tert-butyl-4-hydroxybenzoic acid Preparation Products And Raw materials |
|