|
|
| | N-Succinimidyl 3-(bromoacetamido)propionate Basic information |
| | N-Succinimidyl 3-(bromoacetamido)propionate Chemical Properties |
| Melting point | 93-94°C | | density | 1.69±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | Chloroform (Slightly, Heated), Methanol (Slightly) | | form | Solid | | pka | 12.96±0.46(Predicted) | | color | Off-White to White Waxy | | InChI | 1S/C9H11BrN2O5/c10-5-6(13)11-4-3-9(16)17-12-7(14)1-2-8(12)15/h1-5H2,(H,11,13) | | InChIKey | WGMMKWFUXPMTRW-UHFFFAOYSA-N | | SMILES | O=C(CCC1=O)N1OC(CCNC(CBr)=O)=O | | CAS DataBase Reference | 57159-62-3 |
| WGK Germany | WGK 3 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | N-Succinimidyl 3-(bromoacetamido)propionate Usage And Synthesis |
| Description | 3-(2-bromoacetamido)propanoic acid NHS ester is a PEG linker containing a bromide group and an NHS ester. The hydrophilic PEG spacer increases solubility in aqueous media. The bromide (Br) is a very good leaving group for nucleophilic substitution reactions. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. | | Chemical Properties | White Solid | | Uses | A sulfhydryl and amino reactive heterobifunctional protein crosslinking reagent. Spacer Arm: 6.2 Angstroms | | Uses | A sulfhydryl and amino reactive heterobifunctional protein crosslinking reagent.
Spacer Arm: 6.2 Angstroms | | reaction suitability | reagent type: cross-linking reagent | | IC 50 | PEGs; Alkyl/ether; Cleavable Linker |
| | N-Succinimidyl 3-(bromoacetamido)propionate Preparation Products And Raw materials |
|