|
|
| | (5-bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone Basic information |
| Product Name: | (5-bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone | | Synonyms: | (5-bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone;Methanone, (5-bromo-2-chlorophenyl)(4-ethoxyphenyl)-;(5-broMo-2-chlorophenyl)(4-ethoxyphenyl)-;5-broMo-2-chloro-4'-ethoxybenzophenone;(5-BroMo-2-chlorophenyl)(4-ethoxypheny)Methanone;Dapagliflozin Intermediate I;Dapagliflozin Impurity 6Q: What is
Dapagliflozin Impurity 6 Q: What is the CAS Number of
Dapagliflozin Impurity 6 Q: What is the storage condition of
Dapagliflozin Impurity 6 Q: What are the applications of
Dapagliflozin Impurity 6;Dapagliflozin Impurity 18 | | CAS: | 461432-22-4 | | MF: | C15H12BrClO2 | | MW: | 339.61 | | EINECS: | 630-623-9 | | Product Categories: | API intermediates;API | | Mol File: | 461432-22-4.mol |  |
| | (5-bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone Chemical Properties |
| Boiling point | 439.2±40.0 °C(Predicted) | | density | 1.437 | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Low-Melting Solid | | color | Off-White to Pale Yellow | | InChI | InChI=1S/C15H12BrClO2/c1-2-19-12-6-3-10(4-7-12)15(18)13-9-11(16)5-8-14(13)17/h3-9H,2H2,1H3 | | InChIKey | OEURLNJEQCLGPS-UHFFFAOYSA-N | | SMILES | C(C1=CC(Br)=CC=C1Cl)(C1=CC=C(OCC)C=C1)=O | | CAS DataBase Reference | 461432-22-4 |
| | (5-bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone Usage And Synthesis |
| Uses | (5-Bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone is an intermediate used in the improved synthesis of Dapagliflozin, a novel selective sodium-glucose co-transporter type II (SGLT2) inhibitor. | | Synthesis | Under the protection of nitrogen, 2.1 g of tert-butyldimethylchlorosilane prepared in step 1) was mixed with 5-bromo-2-chlorobenzoyl chloride in anhydrous dichloromethane and stirred for 30 min at 0 to 10 °C. Subsequently, 1.2 mol of phenethyl ether and 1.1 mol of ferric chloride were sequentially added to the reaction system, and the reaction temperature was maintained at 14.7 °C, and the reaction continued to be stirred for 5 hours. After completion of the reaction, the reaction mixture was quenched by pouring it into ice water, extracted with dichloromethane, the organic phase was washed with water, and 31 g of 5-bromo-2-chloro-4'-ethoxy benzophenone (intermediate of dagliflozin) was obtained after concentration in 91.4% yield and 99.49% purity. | | References | [1] Patent: CN107200683, 2017, A. Location in patent: Paragraph 0029; 0035; 0039; 0043; 0047 [2] Patent: CN107417515, 2017, A. Location in patent: Paragraph 0030; 0032; 0034; 0036; 0038; 0040 [3] Patent: CN103739581, 2016, B. Location in patent: Paragraph 0228; 0229 [4] Patent: WO2012/25857, 2012, A1. Location in patent: Page/Page column 20 [5] Patent: CN106316803, 2017, A. Location in patent: Paragraph 0014 |
| | (5-bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone Preparation Products And Raw materials |
|