|
|
| | 2,3-Epoxypropyltrimethylammonium chloride Basic information |
| Product Name: | 2,3-Epoxypropyltrimethylammonium chloride | | Synonyms: | GLYCIDYLTRIMETHYLAMMONIUM CHLORIDE TECH;N,N',N''-Trimethloxiranemethanaminium chloride;(2,3)-Epoxypropyl)trimethyl;(2,3-epoxypropyl)trimethyl-ammoniuchloride;glycidyltrimethylammonium;glytac;glytaca100;Oxiranemethanaminium,N,N,N-trimethyl-,chloride | | CAS: | 3033-77-0 | | MF: | C6H14ClNO | | MW: | 151.63 | | EINECS: | 221-221-0 | | Product Categories: | | | Mol File: | 3033-77-0.mol |  |
| | 2,3-Epoxypropyltrimethylammonium chloride Chemical Properties |
| Melting point | 137-139 °C | | density | 1.13 g/mL at 20 °C(lit.) | | refractive index | 1.48 | | Fp | 170 °C | | storage temp. | 2-8°C | | solubility | Methanol (Slightly), Water (Sparingly) | | form | Oil | | color | Colourless | | Water Solubility | 852g/L at 20℃ | | BRN | 3914931 | | Stability: | Stable. Incompatible with oxidizing agents | | InChI | InChI=1S/C6H14NO.ClH/c1-7(2,3)4-6-5-8-6;/h6H,4-5H2,1-3H3;1H/q+1;/p-1 | | InChIKey | PUVAFTRIIUSGLK-UHFFFAOYSA-M | | SMILES | [N+](C)(C)(C)CC1OC1.[Cl-] | | CAS DataBase Reference | 3033-77-0(CAS DataBase Reference) | | EPA Substance Registry System | Glycidyltrimethylammonium chloride (3033-77-0) |
| | 2,3-Epoxypropyltrimethylammonium chloride Usage And Synthesis |
| Description | Used in the production of cationic starch for the paper
industry, 2,3-Epoxypropyl trimethyl ammonium chloride
(EPTMAC) caused contact dermatitis in the
workers. | | Chemical Properties | solid | | Uses | Glycidyltrimethylammonium chloride be used as a derivatizing agent to synthesize N-(2-hydroxypropyl)-3-trimethylammonium chitosan chloride (HTCC), a water-soluble chitosan derivative, by reacting with chitosan. HTCC can form nanocomposite films with silver nanoparticles that show good antimicrobial property and optical transparency. Cationic starches can also be prepared by derivatization of starch with GTMAC. | | Uses | Reagent used for synthesis and antimicrobial activity of a water soluble chitosan derivative with a fiber-reactive group. | | General Description | Glycidyltrimethylammonium chloride (GTMAC) is a cationizing agent commonly used for starch modification. | | Contact allergens | Used in the production of cationic starch for the paper
industry; EPTMAC caused contact dermatitis in
workers. | | Safety Profile | Suspected carcinogen.
Poison by subcutaneous route. Mutation
data reported. When heated to
decomposition it emits toxic fumes of Cl-,
NH3, and NOx. See also AMMONIUM
CHLORIDE. |
| | 2,3-Epoxypropyltrimethylammonium chloride Preparation Products And Raw materials |
|