- Sulconazole nitrate
-
- $0.00 / 1Kg/Bag
-
2026-04-20
- CAS:61318-91-0
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 500kg/month
- Sulconazole Nitrate
-
- $0.00 / 1kg
-
2026-04-14
- CAS:61318-91-0
- Min. Order: 1kg
- Purity: 98% up by HPLC
- Supply Ability: 20tons
|
| | Sulconazole nitrate Basic information | | Uses |
| Product Name: | Sulconazole nitrate | | Synonyms: | SULCONAZOLE NITRATE SALT;(+-)-1-(2,4-dichloro-beta-((4-chlorobenzyl)thio)phenethyl)imidazolenitrate;,mononitrate,(+-)-;1-[2-(P-CHLOROBENZYLTHIO)-2-(2,4-DICHLOROPHENYL)ETHYL]-1H-IMIDAZOLE NITRATE;1-[2-(P-CHLOROBENZYLTHIO)-2-(2,4-DICHLOROPHENYL)ETHYL]-1H-IMIDAZOLE NITRATE SALT;1-(2-[p-chlorobenzylthio]-2-[2,4-dichlorophenyl]ethyl)-1h-imidazole;1H-Imidazole, 1-[2-[[(4-chlorophenyl)methyl]thio]-2-(2,4-dichlorophenyl)ethyl]-, (+-)-, mononitrate;1H-Imidazole, 1-[2-[[(4-chlorophenyl)methyl]thio]-2-(2,4-dichlorophenyl)ethyl]-, mononitrate (9CI) | | CAS: | 61318-91-0 | | MF: | C18H16Cl3N3O3S | | MW: | 460.76 | | EINECS: | 624-696-6 | | Product Categories: | Inhibitors;ZANTAC | | Mol File: | 61318-91-0.mol |  |
| | Sulconazole nitrate Chemical Properties |
| Melting point | 130.5-132℃ | | storage temp. | room temp | | solubility | DMF: 25 mg/ml; DMSO: 25 mg/ml; DMSO:PBS (pH 7.2) (1:2): 0.33 mg/ml; Ethanol: 0.1 mg/ml | | form | powder to crystal | | color | white | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C18H15Cl3N2S.HNO3/c19-14-3-1-13(2-4-14)11-24-18(10-23-8-7-22-12-23)16-6-5-15(20)9-17(16)21;2-1(3)4/h1-9,12,18H,10-11H2;(H,2,3,4) | | InChIKey | CRKGMGQUHDNAPB-UHFFFAOYSA-N | | SMILES | C1(C(Cl)=CC(Cl)=CC=1)C(SCC1=CC=C(Cl)C=C1)CN1C=NC=C1.[N+]([O-])(=O)O | | CAS DataBase Reference | 61318-91-0 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36 | | WGK Germany | 3 | | RTECS | NI4475000 | | HS Code | 2933290000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Sulconazole nitrate Usage And Synthesis |
| Uses | Sulconazole Nitrate is an antifungal agent which prevents fungal growth by inhibiting sterol synthesis. | | Chemical Properties | White or off-white crystalline powder. | | Uses | H2 antihistamine | | Uses | Sulconazole Nitrate is an antifungal agent which prevents fungal growth by inhibiting sterol synthesis. | | Definition | ChEBI: Sulconazole nitrate is an organic nitrate salt, a conazole antifungal drug and an imidazole antifungal drug. |
| | Sulconazole nitrate Preparation Products And Raw materials |
|