- Xanthene-9-carboxylic acid
-
- $2.00 / 1KG
-
2021-07-09
- CAS:82-07-5
- Min. Order: 1KG
- Purity: 99.7%
- Supply Ability: 500 Ton/Tons per Month
|
| | XANTHENE-9-CARBOXYLIC ACID Basic information |
| | XANTHENE-9-CARBOXYLIC ACID Chemical Properties |
| Melting point | 221-225 °C (lit.) | | Boiling point | 391.3±41.0 °C(Predicted) | | density | 1.335±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | methanol: 0.1 g/mL, clear | | pka | 4.30±0.20(Predicted) | | color | White to Off-White | | Water Solubility | Insoluble in water. | | BRN | 174414 | | InChI | InChI=1S/C14H10O3/c15-14(16)13-9-5-1-3-7-11(9)17-12-8-4-2-6-10(12)13/h1-8,13H,(H,15,16) | | InChIKey | VSBFNCXKYIEYIS-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)C2=C(C=CC=C2)OC2=C1C=CC=C2 | | CAS DataBase Reference | 82-07-5(CAS DataBase Reference) |
| | XANTHENE-9-CARBOXYLIC ACID Usage And Synthesis |
| Chemical Properties | White to Off-White Solid | | Uses | Xanthene-9-carboxylic Acid is xanthrene derivative that is capable of inhibiting the TTR conformational changes facilitating amyloid fibril formation. | | Uses | Transesterification of the ethyl ester of commercially available xanthene-9-carboxylic acid yeildits 3- quinuclidinyl ester. | | Definition | ChEBI: Xanthene-9-carboxylic acid is a member of xanthenes. |
| | XANTHENE-9-CARBOXYLIC ACID Preparation Products And Raw materials |
|